[(3aR,4R,5R,9aR,9bS)-4,9a-dihydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,9b-tetrahydroazuleno[4,5-b]furan-5-yl] 3-methylbut-2-enoate
Internal ID | e314992e-027c-4bbc-bad1-5db86fe31815 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters |
IUPAC Name | [(3aR,4R,5R,9aR,9bS)-4,9a-dihydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,9b-tetrahydroazuleno[4,5-b]furan-5-yl] 3-methylbut-2-enoate |
SMILES (Canonical) | CC1=CC(=O)C2=C(C(C(C3C(C12O)OC(=O)C3=C)O)OC(=O)C=C(C)C)C |
SMILES (Isomeric) | CC1=CC(=O)C2=C([C@H]([C@@H]([C@@H]3[C@@H]([C@@]12O)OC(=O)C3=C)O)OC(=O)C=C(C)C)C |
InChI | InChI=1S/C20H22O7/c1-8(2)6-13(22)26-17-11(5)15-12(21)7-9(3)20(15,25)18-14(16(17)23)10(4)19(24)27-18/h6-7,14,16-18,23,25H,4H2,1-3,5H3/t14-,16-,17-,18+,20-/m1/s1 |
InChI Key | AGGJZXSACXUOJX-ILCCUAOLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H22O7 |
Molecular Weight | 374.40 g/mol |
Exact Mass | 374.13655304 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 0.40 |
[(3aR,4R,5R,9aR,9bS)-4,9a-dihydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,9b-tetrahydroazuleno[4,5-b]furan-5-yl] 3-methylbut-2-enoate |
DTXSID30921890 |
A806716 |
[(3aR,4R,5R,9aR,9bS)-6,9-dimethyl-3-methylidene-4,9a-bis(oxidanyl)-2,7-bis(oxidanylidene)-3a,4,5,9b-tetrahydroazuleno[4,5-b]furan-5-yl] 3-methylbut-2-enoate |
2-Butenoic acid, 3-methyl-, 2,3,3a,4,5,7,9a,9b-octahydro-4,9a-dihydroxy-6,9-dimethyl-3-methylene-2,7-dioxoazuleno(4,5-b)furan-5-yl ester, (3aR-(3aalpha,4alpha,5beta,9aalpha,9bbeta))- |
3-methyl-2-butenoic acid [(3aR,4R,5R,9aR,9bS)-4,9a-dihydroxy-6,9-dimethyl-3-methylene-2,7-dioxo-3a,4,5,9b-tetrahydroazuleno[4,5-b]furan-5-yl] ester |
4,9a-Dihydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-2,3,3a,4,5,7,9a,9b-octahydroazuleno[4,5-b]furan-5-yl 3-methylbut-2-enoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.44% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.02% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.30% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.36% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.98% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.42% | 95.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.87% | 94.08% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.79% | 99.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.06% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.32% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.07% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.60% | 94.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.46% | 97.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.16% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.76% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Montanoa tomentosa |
PubChem | 163988 |
LOTUS | LTS0124543 |
wikiData | Q103816766 |