[2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate
Internal ID | 4977cf1c-6f98-4ae9-a405-85fc540895fb |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols > Glycosylmonoacylglycerols |
IUPAC Name | [2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate |
SMILES (Canonical) | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C33H58O14/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25(36)43-19-22(35)20-44-32-31(42)29(40)27(38)24(47-32)21-45-33-30(41)28(39)26(37)23(18-34)46-33/h6-7,9-10,22-24,26-35,37-42H,2-5,8,11-21H2,1H3/b7-6-,10-9-/t22?,23-,24-,26+,27+,28+,29+,30-,31-,32-,33+/m1/s1 |
InChI Key | UHISGSDYAIIBMO-OCOVFIGMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H58O14 |
Molecular Weight | 678.80 g/mol |
Exact Mass | 678.38265652 g/mol |
Topological Polar Surface Area (TPSA) | 225.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
![2D Structure of [2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate 2D Structure of [2-hydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate](https://plantaedb.com/storage/docs/compounds/2023/11/3efa1750-852f-11ee-abd9-2d2535fa3ee8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.06% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.25% | 96.09% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 97.46% | 85.94% |
CHEMBL2581 | P07339 | Cathepsin D | 96.96% | 98.95% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.31% | 97.29% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 92.66% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.38% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.18% | 92.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.15% | 96.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.46% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.66% | 92.86% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.24% | 94.73% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.51% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.11% | 97.25% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.56% | 94.33% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.23% | 92.32% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.22% | 96.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.78% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.12% | 89.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.02% | 89.63% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.19% | 96.47% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.38% | 82.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.26% | 86.33% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.03% | 83.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.95% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 5317594 |
LOTUS | LTS0076749 |
wikiData | Q105272912 |