(1S,14S)-11,14-dihydroxy-7,7,20,20-tetramethyl-2,6,21,25-tetraoxahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-3(12),4,8,10,15(24),16,18,22-octaen-13-one
| Internal ID | 66975033-fb43-444d-9545-f97e1b8595f7 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 3-prenylated isoflavanones |
| IUPAC Name | (1S,14S)-11,14-dihydroxy-7,7,20,20-tetramethyl-2,6,21,25-tetraoxahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-3(12),4,8,10,15(24),16,18,22-octaen-13-one |
| SMILES (Canonical) | CC1(C=CC2=CC3=C(C=C2O1)OC4C3(C(=O)C5=C(O4)C=C6C(=C5O)C=CC(O6)(C)C)O)C |
| SMILES (Isomeric) | CC1(C=CC2=CC3=C(C=C2O1)O[C@@H]4[C@@]3(C(=O)C5=C(O4)C=C6C(=C5O)C=CC(O6)(C)C)O)C |
| InChI | InChI=1S/C25H22O7/c1-23(2)7-5-12-9-14-17(10-15(12)31-23)29-22-25(14,28)21(27)19-18(30-22)11-16-13(20(19)26)6-8-24(3,4)32-16/h5-11,22,26,28H,1-4H3/t22-,25+/m0/s1 |
| InChI Key | HMLFQVDHVQECID-WIOPSUGQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H22O7 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.13655304 g/mol |
| Topological Polar Surface Area (TPSA) | 94.40 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of (1S,14S)-11,14-dihydroxy-7,7,20,20-tetramethyl-2,6,21,25-tetraoxahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-3(12),4,8,10,15(24),16,18,22-octaen-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/3ed2f460-8561-11ee-87fb-378a5c9de6e3.jpg "2D Structure of (1S,14S)-11,14-dihydroxy-7,7,20,20-tetramethyl-2,6,21,25-tetraoxahexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosa-3(12),4,8,10,15(24),16,18,22-octaen-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.50% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.44% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.57% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.47% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.92% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.93% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.22% | 85.14% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.40% | 95.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.86% | 96.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.68% | 85.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.45% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.37% | 90.00% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 82.66% | 80.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eriosema kraussianum |
| PubChem | 162891488 |
| LOTUS | LTS0274556 |
| wikiData | Q105030559 |