[(1R,3R,5S,7S,9R,10E,12E,14R,15S,18Z,20E,22R,23S,25R,26R,27R,30S,31S,33R,34S,35R)-15-[(E,2S)-10-[(N,N'-dimethylcarbamimidoyl)amino]dec-6-en-2-yl]-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl] 9-methyldecanoate
| Internal ID | cfbed70d-318c-40e2-8066-d6be9f00b01f |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | [(1R,3R,5S,7S,9R,10E,12E,14R,15S,18Z,20E,22R,23S,25R,26R,27R,30S,31S,33R,34S,35R)-15-[(E,2S)-10-[(N,N'-dimethylcarbamimidoyl)amino]dec-6-en-2-yl]-5,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-3-yl] 9-methyldecanoate |
| SMILES (Canonical) | CC1CCC(C(C(CC(C(C=CC=C(C(=O)OC(C(C=CC=C(C(CC(CC(CC(CC2CC(C(C(O2)(CC1O)O)O)O)OC(=O)CCCCCCCC(C)C)O)O)O)C)C)C(C)CCCC=CCCCNC(=NC)NC)C)C)O)O)C)O |
| SMILES (Isomeric) | C[C@H]1CC[C@H]([C@H]([C@@H](C[C@@H]([C@@H](/C=C/C=C(\C(=O)O[C@H]([C@@H](/C=C/C=C(/[C@@H](C[C@H](C[C@@H](C[C@H](C[C@H]2C[C@H]([C@@H]([C@](O2)(C[C@@H]1O)O)O)O)OC(=O)CCCCCCCC(C)C)O)O)O)\C)C)[C@@H](C)CCC/C=C/CCCNC(=NC)NC)/C)C)O)O)C)O |
| InChI | InChI=1S/C65H115N3O15/c1-42(2)25-19-15-14-17-21-31-60(77)81-52-36-50(69)35-51(70)37-55(72)43(3)27-23-29-47(7)61(46(6)26-20-16-12-13-18-22-34-68-64(66-10)67-11)82-63(79)48(8)30-24-28-44(4)56(73)40-57(74)49(9)54(71)33-32-45(5)59(76)41-65(80)62(78)58(75)39-53(38-52)83-65/h12-13,23-24,27-30,42,44-47,49-59,61-62,69-76,78,80H,14-22,25-26,31-41H2,1-11H3,(H2,66,67,68)/b13-12+,28-24+,29-23+,43-27+,48-30-/t44-,45+,46+,47-,49-,50+,51+,52-,53+,54-,55-,56+,57-,58-,59+,61+,62+,65-/m1/s1 |
| InChI Key | PAHJBJCXISXISU-ONNWDYGPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C65H115N3O15 |
| Molecular Weight | 1178.60 g/mol |
| Exact Mass | 1177.83281997 g/mol |
| Topological Polar Surface Area (TPSA) | 301.00 Ų |
| XlogP | 9.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.76% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.84% | 89.63% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.58% | 95.17% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 96.47% | 96.38% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.67% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.60% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.38% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.33% | 97.09% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 94.81% | 95.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.94% | 95.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.29% | 95.89% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.00% | 94.80% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.80% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.40% | 94.73% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.93% | 96.47% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 89.86% | 85.31% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.84% | 94.75% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.84% | 91.07% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.34% | 94.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.01% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.55% | 96.77% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.36% | 89.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.62% | 92.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.32% | 96.90% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 83.90% | 95.92% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.65% | 95.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.38% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.30% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.16% | 86.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.95% | 97.79% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.30% | 94.23% |
| CHEMBL5028 | O14672 | ADAM10 | 82.14% | 97.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.05% | 82.69% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.94% | 98.75% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 81.68% | 83.57% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.50% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.29% | 91.19% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.92% | 94.66% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.37% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163191833 |
| LOTUS | LTS0077716 |
| wikiData | Q105204531 |