3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 3279f44c-e703-4bc7-a675-7e105e492eae |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@@H]([C@H]([C@H](CO5)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O16/c1-38-14-3-2-9(4-11(14)28)25-22(35)20(33)17-12(29)5-10(6-15(17)42-25)41-27-24(37)21(34)19(32)16(43-27)8-40-26-23(36)18(31)13(30)7-39-26/h2-6,13,16,18-19,21,23-24,26-32,34-37H,7-8H2,1H3/t13-,16+,18-,19+,21-,23+,24+,26+,27+/m0/s1 |
InChI Key | QBWZGCGJFJZSIH-IHDBIPSSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O16 |
Molecular Weight | 610.50 g/mol |
Exact Mass | 610.15338487 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
![2D Structure of 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/3e713a10-857a-11ee-a912-53c0f8a9941c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.20% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.80% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 97.25% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.57% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.31% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.51% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.75% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 90.46% | 95.78% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.25% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.73% | 95.89% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.24% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.23% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.79% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.69% | 94.73% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 86.01% | 95.53% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.79% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.57% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.76% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.03% | 90.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.49% | 92.94% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.19% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.02% | 92.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.00% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lomelosia caucasica |
PubChem | 163017503 |
LOTUS | LTS0074463 |
wikiData | Q105218054 |