(3E,4S,5S)-3-dodecylidene-4-hydroxy-5-methyloxolan-2-one
Internal ID | 7bb1d3f1-90ee-4584-ac58-4ab5d0248a19 |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | (3E,4S,5S)-3-dodecylidene-4-hydroxy-5-methyloxolan-2-one |
SMILES (Canonical) | CCCCCCCCCCCC=C1C(C(OC1=O)C)O |
SMILES (Isomeric) | CCCCCCCCCCC/C=C/1\[C@@H]([C@@H](OC1=O)C)O |
InChI | InChI=1S/C17H30O3/c1-3-4-5-6-7-8-9-10-11-12-13-15-16(18)14(2)20-17(15)19/h13-14,16,18H,3-12H2,1-2H3/b15-13+/t14-,16+/m0/s1 |
InChI Key | NSMMPEJLOMMKCX-WPDDIUJQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H30O3 |
Molecular Weight | 282.40 g/mol |
Exact Mass | 282.21949481 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 5.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.41% | 98.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.81% | 92.08% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.08% | 99.17% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.76% | 89.63% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.72% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.27% | 89.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.00% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.08% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.07% | 86.33% |
CHEMBL299 | P17252 | Protein kinase C alpha | 83.43% | 98.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.27% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.27% | 90.17% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.17% | 96.47% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.01% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lindera communis |
PubChem | 10265812 |
LOTUS | LTS0060019 |
wikiData | Q105185128 |