[(1R,4aS,5S,6S,8aR)-5-hydroxy-6-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] 2-hydroxy-3-(4-hydroxyphenyl)propanoate
Internal ID | e25898a3-27e9-4814-99ca-a33c1545ee78 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [(1R,4aS,5S,6S,8aR)-5-hydroxy-6-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] 2-hydroxy-3-(4-hydroxyphenyl)propanoate |
SMILES (Canonical) | CC12CCC(C(C1C(=CCC2OC(=O)C(CC3=CC=C(C=C3)O)O)COC4C(C(C(C(O4)CO)O)O)O)O)C(=C)C(=O)OC |
SMILES (Isomeric) | C[C@@]12CC[C@H]([C@@H]([C@H]1C(=CC[C@H]2OC(=O)C(CC3=CC=C(C=C3)O)O)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)C(=C)C(=O)OC |
InChI | InChI=1S/C31H42O13/c1-15(28(39)41-3)19-10-11-31(2)22(44-29(40)20(34)12-16-4-7-18(33)8-5-16)9-6-17(23(31)24(19)35)14-42-30-27(38)26(37)25(36)21(13-32)43-30/h4-8,19-27,30,32-38H,1,9-14H2,2-3H3/t19-,20?,21+,22+,23+,24-,25+,26-,27+,30+,31-/m0/s1 |
InChI Key | XFACIJUJGNMSOZ-OHZKPXRCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H42O13 |
Molecular Weight | 622.70 g/mol |
Exact Mass | 622.26254139 g/mol |
Topological Polar Surface Area (TPSA) | 213.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.72% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.58% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.72% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.79% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.12% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.26% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 87.26% | 85.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 87.24% | 89.67% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.10% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.10% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.51% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.08% | 92.62% |
CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 85.42% | 91.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.48% | 94.00% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 84.42% | 94.97% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.10% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.36% | 96.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.30% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.25% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.87% | 97.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.72% | 96.21% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.30% | 95.83% |
CHEMBL233 | P35372 | Mu opioid receptor | 82.30% | 97.93% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.41% | 97.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.71% | 96.61% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.64% | 92.50% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.27% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ixeris repens |
PubChem | 101589323 |
LOTUS | LTS0170911 |
wikiData | Q105326867 |