[2,6,9,11,13,14-hexahydroxy-3-(hydroxymethyl)-7,10-dimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadec-3-en-12-yl] 1H-pyrrole-2-carboxylate
| Internal ID | 062601e1-a3e7-4777-9a44-f8fa612a9e92 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | [2,6,9,11,13,14-hexahydroxy-3-(hydroxymethyl)-7,10-dimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadec-3-en-12-yl] 1H-pyrrole-2-carboxylate |
| SMILES (Canonical) | CC(C)C1(C(C2(C3(CC4(C1(C2(C5(C3(CC=C(C5O)CO)O)O4)O)C)O)C)O)OC(=O)C6=CC=CN6)O |
| SMILES (Isomeric) | CC(C)C1(C(C2(C3(CC4(C1(C2(C5(C3(CC=C(C5O)CO)O)O4)O)C)O)C)O)OC(=O)C6=CC=CN6)O |
| InChI | InChI=1S/C25H33NO10/c1-12(2)22(32)17(35-16(29)14-6-5-9-26-14)23(33)18(3)11-21(31)19(22,4)25(23,34)24(36-21)15(28)13(10-27)7-8-20(18,24)30/h5-7,9,12,15,17,26-28,30-34H,8,10-11H2,1-4H3 |
| InChI Key | SMHZZOWSOCFYFL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H33NO10 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.21044625 g/mol |
| Topological Polar Surface Area (TPSA) | 193.00 Ų |
| XlogP | -1.90 |
| There are no found synonyms. |
![2D Structure of [2,6,9,11,13,14-hexahydroxy-3-(hydroxymethyl)-7,10-dimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadec-3-en-12-yl] 1H-pyrrole-2-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/3e16c2b0-8610-11ee-8f43-fff33b46a414.jpg "2D Structure of [2,6,9,11,13,14-hexahydroxy-3-(hydroxymethyl)-7,10-dimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadec-3-en-12-yl] 1H-pyrrole-2-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.89% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.67% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.11% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.20% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.00% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.75% | 97.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.94% | 95.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.14% | 91.07% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.37% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.85% | 97.09% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.10% | 97.28% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.41% | 89.67% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.24% | 85.30% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.99% | 93.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.81% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ryania speciosa |
| PubChem | 85227647 |
| LOTUS | LTS0165705 |
| wikiData | Q105255943 |