(3E)-7-methoxy-3-(pyridin-3-ylmethylidene)chromen-4-one
Internal ID | ba9c6b59-6bb6-4852-8ba2-948963db7ea2 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
IUPAC Name | (3E)-7-methoxy-3-(pyridin-3-ylmethylidene)chromen-4-one |
SMILES (Canonical) | COC1=CC2=C(C=C1)C(=O)C(=CC3=CN=CC=C3)CO2 |
SMILES (Isomeric) | COC1=CC2=C(C=C1)C(=O)/C(=C/C3=CN=CC=C3)/CO2 |
InChI | InChI=1S/C16H13NO3/c1-19-13-4-5-14-15(8-13)20-10-12(16(14)18)7-11-3-2-6-17-9-11/h2-9H,10H2,1H3/b12-7+ |
InChI Key | GRYIOZGUFRAETE-KPKJPENVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H13NO3 |
Molecular Weight | 267.28 g/mol |
Exact Mass | 267.08954328 g/mol |
Topological Polar Surface Area (TPSA) | 48.40 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.53% | 91.11% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 94.94% | 92.51% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.93% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.16% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.33% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.45% | 98.95% |
CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 90.37% | 92.86% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.93% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.87% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.61% | 96.09% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.44% | 85.30% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.46% | 94.80% |
CHEMBL1907 | P15144 | Aminopeptidase N | 88.11% | 93.31% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.38% | 94.45% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.85% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.12% | 95.89% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.99% | 99.18% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.55% | 95.93% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.45% | 97.53% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.32% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.16% | 99.23% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 84.06% | 100.00% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 83.75% | 95.55% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.62% | 96.12% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.57% | 96.67% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.01% | 93.40% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.97% | 80.96% |
CHEMBL2535 | P11166 | Glucose transporter | 81.96% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.40% | 97.09% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.88% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Derris ovalifolia |
PubChem | 19600720 |
LOTUS | LTS0228784 |
wikiData | Q105016836 |