(3E)-3-(3,4-dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)furan-2(3H)-one
| Internal ID | 3b4e34d8-b544-4411-a879-91a525d4770c |
| Taxonomy | Benzenoids > Phenols > Benzenediols > Catechols |
| IUPAC Name | (3E)-5-(3,4-dihydroxyphenyl)-3-[(3,4-dihydroxyphenyl)methylidene]furan-2-one |
| SMILES (Canonical) | C1=CC(=C(C=C1C=C2C=C(OC2=O)C3=CC(=C(C=C3)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1/C=C/2\C=C(OC2=O)C3=CC(=C(C=C3)O)O)O)O |
| InChI | InChI=1S/C17H12O6/c18-12-3-1-9(6-14(12)20)5-11-8-16(23-17(11)22)10-2-4-13(19)15(21)7-10/h1-8,18-21H/b11-5+ |
| InChI Key | TZBZGNPXKXHFKI-VZUCSPMQSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 2.60 |
| 145588-13-2 |
| (3E)-3-(3,4-dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)furan-2(3H)-one |
| (3E)-5-(3,4-dihydroxyphenyl)-3-[(3,4-dihydroxyphenyl)methylidene]furan-2-one |
| 3-(3,4-Dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)-2(3H)-furanone |
| BE 23372M |
| SCHEMBL1527413 |
| CHEBI:65473 |
| DTXSID401137371 |
| Q27133917 |
| (3E)-5-(3,4-Dihydroxyphenyl)-3-[(3,4-dihydroxyphenyl)methylene]-2(3H)-furanone |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.69% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.12% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.09% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.50% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.46% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.79% | 99.15% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.98% | 93.40% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.08% | 96.12% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.82% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.31% | 99.23% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.32% | 85.30% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.06% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5311105 |
| LOTUS | LTS0232929 |
| wikiData | Q27133917 |