1-[(3S,8R,9S,10R,13S,14S,17S)-14,17-dihydroxy-3-[(2R,4S,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methoxyethanone
Internal ID | 7d62936e-ad03-4494-ad13-84dca419fe89 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 1-[(3S,8R,9S,10R,13S,14S,17S)-14,17-dihydroxy-3-[(2R,4S,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methoxyethanone |
SMILES (Canonical) | CC1C(C(CC(O1)OC2CCC3(C4CCC5(C(C4CC=C3C2)(CCC5(C(=O)COC)O)O)C)C)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@@]3([C@H]4CC[C@]5([C@@]([C@@H]4CC=C3C2)(CC[C@]5(C(=O)COC)O)O)C)C)OC)O |
InChI | InChI=1S/C29H46O8/c1-17-25(31)22(35-5)15-24(36-17)37-19-8-10-26(2)18(14-19)6-7-21-20(26)9-11-27(3)28(21,32)12-13-29(27,33)23(30)16-34-4/h6,17,19-22,24-25,31-33H,7-16H2,1-5H3/t17-,19+,20+,21-,22+,24+,25-,26+,27+,28+,29-/m1/s1 |
InChI Key | RGUZABVCHPAKJM-XFOXNFGNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H46O8 |
Molecular Weight | 522.70 g/mol |
Exact Mass | 522.31926842 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.22% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.87% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.56% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.51% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.43% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.76% | 97.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.90% | 96.38% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.57% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.62% | 94.45% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.85% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.80% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.08% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.80% | 95.89% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 84.88% | 94.50% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 84.67% | 87.16% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 84.01% | 98.59% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.91% | 85.14% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.83% | 94.33% |
CHEMBL5028 | O14672 | ADAM10 | 81.17% | 97.50% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 81.11% | 95.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.05% | 98.95% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.41% | 97.53% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.09% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 102479615 |
LOTUS | LTS0141570 |
wikiData | Q105236101 |