1-[2-[[2-[(3-Amino-10,10-dichloro-2-hydroxydecanoyl)amino]-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid
| Internal ID | b0a568aa-8281-4750-9a5c-18069e174ac2 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 1-[2-[[2-[(3-amino-10,10-dichloro-2-hydroxydecanoyl)amino]-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)N(C)C(CC(C)C)C(=O)N1CCCC1C(=O)O)NC(=O)C(C(CCCCCCC(Cl)Cl)N)O |
| SMILES (Isomeric) | CCC(C)C(C(=O)N(C)C(CC(C)C)C(=O)N1CCCC1C(=O)O)NC(=O)C(C(CCCCCCC(Cl)Cl)N)O |
| InChI | InChI=1S/C28H50Cl2N4O6/c1-6-18(4)23(32-25(36)24(35)19(31)12-9-7-8-10-14-22(29)30)27(38)33(5)21(16-17(2)3)26(37)34-15-11-13-20(34)28(39)40/h17-24,35H,6-16,31H2,1-5H3,(H,32,36)(H,39,40) |
| InChI Key | JRCJKKSDWXJOMP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H50Cl2N4O6 |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 608.3107407 g/mol |
| Topological Polar Surface Area (TPSA) | 153.00 Ų |
| XlogP | 2.20 |
| Atomic LogP (AlogP) | 3.30 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 18 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7144 | 71.44% |
| Caco-2 | - | 0.8020 | 80.20% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.5143 | 51.43% |
| Subcellular localzation | Mitochondria | 0.5078 | 50.78% |
| OATP2B1 inhibitior | - | 0.5700 | 57.00% |
| OATP1B1 inhibitior | + | 0.8973 | 89.73% |
| OATP1B3 inhibitior | + | 0.9245 | 92.45% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | - | 0.6837 | 68.37% |
| P-glycoprotein inhibitior | + | 0.6234 | 62.34% |
| P-glycoprotein substrate | + | 0.8017 | 80.17% |
| CYP3A4 substrate | + | 0.6795 | 67.95% |
| CYP2C9 substrate | - | 0.6000 | 60.00% |
| CYP2D6 substrate | - | 0.8016 | 80.16% |
| CYP3A4 inhibition | - | 0.7475 | 74.75% |
| CYP2C9 inhibition | - | 0.8457 | 84.57% |
| CYP2C19 inhibition | - | 0.7824 | 78.24% |
| CYP2D6 inhibition | - | 0.8966 | 89.66% |
| CYP1A2 inhibition | - | 0.8206 | 82.06% |
| CYP2C8 inhibition | - | 0.6870 | 68.70% |
| CYP inhibitory promiscuity | - | 0.9497 | 94.97% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.7800 | 78.00% |
| Carcinogenicity (trinary) | Non-required | 0.6292 | 62.92% |
| Eye corrosion | - | 0.9833 | 98.33% |
| Eye irritation | - | 0.9284 | 92.84% |
| Skin irritation | - | 0.7757 | 77.57% |
| Skin corrosion | - | 0.9120 | 91.20% |
| Ames mutagenesis | - | 0.7100 | 71.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4228 | 42.28% |
| Micronuclear | + | 0.8100 | 81.00% |
| Hepatotoxicity | + | 0.7209 | 72.09% |
| skin sensitisation | - | 0.8619 | 86.19% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.7250 | 72.50% |
| Nephrotoxicity | - | 0.7866 | 78.66% |
| Acute Oral Toxicity (c) | III | 0.6303 | 63.03% |
| Estrogen receptor binding | + | 0.6655 | 66.55% |
| Androgen receptor binding | + | 0.6001 | 60.01% |
| Thyroid receptor binding | - | 0.5000 | 50.00% |
| Glucocorticoid receptor binding | + | 0.6191 | 61.91% |
| Aromatase binding | + | 0.5763 | 57.63% |
| PPAR gamma | + | 0.5810 | 58.10% |
| Honey bee toxicity | - | 0.8647 | 86.47% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.6776 | 67.76% |
| Fish aquatic toxicity | + | 0.8589 | 85.89% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.32% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.22% | 98.95% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 98.78% | 98.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.71% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.50% | 89.63% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.98% | 83.82% |
| CHEMBL204 | P00734 | Thrombin | 97.70% | 96.01% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.31% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.45% | 98.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.08% | 93.56% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 95.94% | 91.76% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.53% | 92.86% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 94.60% | 95.52% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.36% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.30% | 90.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.10% | 91.19% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.84% | 94.66% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 93.63% | 94.50% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 93.38% | 97.50% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 92.69% | 97.86% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 92.55% | 98.24% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.19% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.31% | 90.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.82% | 96.47% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 90.75% | 97.29% |
| CHEMBL4072 | P07858 | Cathepsin B | 90.66% | 93.67% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 90.62% | 98.77% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.70% | 97.29% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 88.31% | 96.76% |
| CHEMBL268 | P43235 | Cathepsin K | 88.29% | 96.85% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.91% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.84% | 96.03% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 87.76% | 97.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.99% | 99.17% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.85% | 93.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 86.77% | 97.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.67% | 94.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.53% | 97.25% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.17% | 95.50% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 86.01% | 92.12% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 85.77% | 97.43% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.34% | 100.00% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.29% | 95.34% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.15% | 97.09% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.94% | 93.18% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.83% | 99.18% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 83.83% | 96.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.83% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.72% | 96.95% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.68% | 97.64% |
| CHEMBL3691 | Q13822 | Autotaxin | 83.49% | 96.39% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.01% | 95.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.83% | 95.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.33% | 95.89% |
| CHEMBL238 | Q01959 | Dopamine transporter | 82.31% | 95.88% |
| CHEMBL5028 | O14672 | ADAM10 | 82.14% | 97.50% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.96% | 99.35% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.84% | 97.47% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.94% | 91.03% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.83% | 95.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.70% | 97.14% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 80.39% | 98.94% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.31% | 96.37% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.22% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85183880 |
| LOTUS | LTS0038963 |
| wikiData | Q104169796 |