[(3aR,4S,6aR,8S,9aR,9bR)-8-acetyloxy-3,6,9-trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2S)-2-acetyloxy-3-chloro-2-methylpropanoate
| Internal ID | 61771ed7-768b-497c-9dfb-2de3e7689cd7 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | [(3aR,4S,6aR,8S,9aR,9bR)-8-acetyloxy-3,6,9-trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2S)-2-acetyloxy-3-chloro-2-methylpropanoate |
| SMILES (Canonical) | CC(=O)OC1CC2C(C1=C)C3C(C(CC2=C)OC(=O)C(C)(CCl)OC(=O)C)C(=C)C(=O)O3 |
| SMILES (Isomeric) | CC(=O)O[C@H]1C[C@@H]2[C@H](C1=C)[C@@H]3[C@@H]([C@H](CC2=C)OC(=O)[C@@](C)(CCl)OC(=O)C)C(=C)C(=O)O3 |
| InChI | InChI=1S/C23H27ClO8/c1-10-7-17(30-22(28)23(6,9-24)32-14(5)26)19-12(3)21(27)31-20(19)18-11(2)16(8-15(10)18)29-13(4)25/h15-20H,1-3,7-9H2,4-6H3/t15-,16-,17-,18-,19+,20+,23+/m0/s1 |
| InChI Key | QOFSCUKKFCFXNG-XQYIGHIWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H27ClO8 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.1394455 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
![2D Structure of [(3aR,4S,6aR,8S,9aR,9bR)-8-acetyloxy-3,6,9-trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2S)-2-acetyloxy-3-chloro-2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/3c73a1f0-8724-11ee-ba38-01078d729e9d.jpg "2D Structure of [(3aR,4S,6aR,8S,9aR,9bR)-8-acetyloxy-3,6,9-trimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-4-yl] (2S)-2-acetyloxy-3-chloro-2-methylpropanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.42% | 97.25% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 96.69% | 97.79% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.88% | 91.11% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.86% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.10% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.09% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.93% | 96.09% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.29% | 97.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.08% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.74% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.68% | 91.19% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.29% | 94.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.65% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Centaurea musimonum |
| PubChem | 162996547 |
| LOTUS | LTS0131059 |
| wikiData | Q105224863 |