26-Hydroxy-4,5,13,13,15,15,31,31-octamethyl-14,32,33-trioxa-7-azaoctacyclo[28.2.1.01,27.04,26.05,23.08,20.010,18.011,16]tritriaconta-8(20),9,11,18,27-pentaene-6,21,29-trione
| Internal ID | edb70d72-95cd-4916-a9a8-64a08949af94 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | 26-hydroxy-4,5,13,13,15,15,31,31-octamethyl-14,32,33-trioxa-7-azaoctacyclo[28.2.1.01,27.04,26.05,23.08,20.010,18.011,16]tritriaconta-8(20),9,11,18,27-pentaene-6,21,29-trione |
| SMILES (Canonical) | CC1(C=C2C(CC3=CC4=C(C=C32)NC(=O)C5(C(CCC6(C5(CCC78C6=CC(=O)C(O7)C(O8)(C)C)C)O)CC4=O)C)C(O1)(C)C)C |
| SMILES (Isomeric) | CC1(C=C2C(CC3=CC4=C(C=C32)NC(=O)C5(C(CCC6(C5(CCC78C6=CC(=O)C(O7)C(O8)(C)C)C)O)CC4=O)C)C(O1)(C)C)C |
| InChI | InChI=1S/C37H45NO7/c1-31(2)18-23-21-16-25-22(13-19(21)14-24(23)32(3,4)44-31)26(39)15-20-9-10-36(42)28-17-27(40)29-33(5,6)45-37(28,43-29)12-11-34(36,7)35(20,8)30(41)38-25/h13,16-18,20,24,29,42H,9-12,14-15H2,1-8H3,(H,38,41) |
| InChI Key | LDIZTUQCKHFFKS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H45NO7 |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.31960277 g/mol |
| Topological Polar Surface Area (TPSA) | 111.00 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.13% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.77% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.99% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.57% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.44% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.34% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.84% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.64% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.62% | 92.94% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.81% | 96.61% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.45% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.07% | 95.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.97% | 82.69% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.37% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.55% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.20% | 93.99% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.98% | 97.28% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.62% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.42% | 94.75% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.62% | 97.05% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.60% | 94.80% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.77% | 94.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.55% | 93.03% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.32% | 91.19% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.30% | 92.88% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 80.59% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163008452 |
| LOTUS | LTS0079604 |
| wikiData | Q105150234 |