(1S,6R,8R,23S,24S,25S)-16,23-dihydroxy-17-methoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-11,15(20),16,18-tetraene-13,21-dione
Internal ID | 8ed2d2f6-2348-4eee-b0a8-a36ea51e587e |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (1S,6R,8R,23S,24S,25S)-16,23-dihydroxy-17-methoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-11,15(20),16,18-tetraene-13,21-dione |
SMILES (Canonical) | CN1CCC23C4C5C(=CC(=O)N4C6=C2C=CC(=C6O)OC)OCC7C(C1)(C5(CC3=O)O)O7 |
SMILES (Isomeric) | CN1CC[C@@]23[C@@H]4[C@@H]5C(=CC(=O)N4C6=C2C=CC(=C6O)OC)OC[C@@H]7[C@](C1)([C@@]5(CC3=O)O)O7 |
InChI | InChI=1S/C23H24N2O7/c1-24-6-5-21-11-3-4-12(30-2)19(28)18(11)25-16(27)7-13-17(20(21)25)22(29,8-14(21)26)23(10-24)15(32-23)9-31-13/h3-4,7,15,17,20,28-29H,5-6,8-10H2,1-2H3/t15-,17+,20+,21-,22+,23-/m1/s1 |
InChI Key | LNUMWHDLOYWNQE-UJDBGMORSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24N2O7 |
Molecular Weight | 440.40 g/mol |
Exact Mass | 440.15835111 g/mol |
Topological Polar Surface Area (TPSA) | 112.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of (1S,6R,8R,23S,24S,25S)-16,23-dihydroxy-17-methoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-11,15(20),16,18-tetraene-13,21-dione 2D Structure of (1S,6R,8R,23S,24S,25S)-16,23-dihydroxy-17-methoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-11,15(20),16,18-tetraene-13,21-dione](https://plantaedb.com/storage/docs/compounds/2023/11/3c22eb90-8552-11ee-8ba1-2d510c224849.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.05% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.06% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.52% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.09% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.76% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 93.37% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.19% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.36% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.66% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.50% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.40% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.76% | 97.25% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.65% | 94.42% |
CHEMBL204 | P00734 | Thrombin | 85.05% | 96.01% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.17% | 93.40% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.73% | 93.99% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.27% | 92.62% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.98% | 98.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.89% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.69% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.53% | 89.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.16% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos icaja |
PubChem | 162974798 |
LOTUS | LTS0178551 |
wikiData | Q103787204 |