(3beta,4alpha,20beta)-3,23-Dihydroxyolean-12-ene-28,29-dioic acid
Internal ID | 555c128a-7131-4398-8fdb-8ae224ca35aa |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,4aR,6aR,6aS,6bR,8aR,9R,10S,12aR,14bS)-10-hydroxy-9-(hydroxymethyl)-2,6a,6b,9,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2,4a-dicarboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)CO)O)C)C)C2C1)C)C(=O)O)C(=O)O |
SMILES (Isomeric) | C[C@@]1(CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H]([C@@]5(C)CO)O)C)C)[C@@H]2C1)C)C(=O)O)C(=O)O |
InChI | InChI=1S/C30H46O6/c1-25(23(33)34)12-14-30(24(35)36)15-13-28(4)18(19(30)16-25)6-7-21-26(2)10-9-22(32)27(3,17-31)20(26)8-11-29(21,28)5/h6,19-22,31-32H,7-17H2,1-5H3,(H,33,34)(H,35,36)/t19-,20+,21+,22-,25-,26-,27-,28+,29+,30-/m0/s1 |
InChI Key | CLXOLTFMHAXJST-MCJGSMSQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H46O6 |
Molecular Weight | 502.70 g/mol |
Exact Mass | 502.32943918 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 5.20 |
(3beta,4alpha,20beta)-3,23-Dihydroxyolean-12-ene-28,29-dioic acid |
![2D Structure of (3beta,4alpha,20beta)-3,23-Dihydroxyolean-12-ene-28,29-dioic acid 2D Structure of (3beta,4alpha,20beta)-3,23-Dihydroxyolean-12-ene-28,29-dioic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3beta4alpha20beta-323-dihydroxyolean-12-ene-2829-dioic-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.39% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.60% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.33% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.08% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.51% | 95.56% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 86.49% | 90.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.60% | 93.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.67% | 91.11% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.00% | 95.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.82% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.28% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phytolacca acinosa |
PubChem | 101297621 |
LOTUS | LTS0122755 |
wikiData | Q104964082 |