3beta,11-Dihydroxy-12-methoxyabieta-8,11,13-triene-7-one
Internal ID | e0a7a5f8-a4b6-46b0-8e54-52216973c014 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (2S,4aS,10aR)-2,5-dihydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
SMILES (Canonical) | CC(C)C1=C(C(=C2C(=C1)C(=O)CC3C2(CCC(C3(C)C)O)C)O)OC |
SMILES (Isomeric) | CC(C)C1=C(C(=C2C(=C1)C(=O)C[C@@H]3[C@@]2(CC[C@@H](C3(C)C)O)C)O)OC |
InChI | InChI=1S/C21H30O4/c1-11(2)12-9-13-14(22)10-15-20(3,4)16(23)7-8-21(15,5)17(13)18(24)19(12)25-6/h9,11,15-16,23-24H,7-8,10H2,1-6H3/t15-,16-,21-/m0/s1 |
InChI Key | RBOFUIKHKQRVJQ-QYWGDWMGSA-N |
Popularity | 2 references in papers |
Molecular Formula | C21H30O4 |
Molecular Weight | 346.50 g/mol |
Exact Mass | 346.21440943 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 4.10 |
(2S,4As,10aR)-2,5-dihydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.45% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.11% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.98% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.88% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.61% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.50% | 85.14% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.81% | 82.69% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.55% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.81% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.95% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.66% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.69% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.25% | 94.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.67% | 91.19% |
CHEMBL1907 | P15144 | Aminopeptidase N | 87.64% | 93.31% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.94% | 92.88% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.92% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.22% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.34% | 94.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.13% | 93.03% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.11% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.78% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 83.27% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.16% | 99.23% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.92% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.41% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.21% | 92.62% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.41% | 90.24% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.31% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
Taxus cuspidata |
PubChem | 12068594 |
LOTUS | LTS0266470 |
wikiData | Q105233216 |