3beta-Tigloyloxy-6beta-acetoxytropane
Internal ID | 85cc992b-f60f-4aed-be4a-5c9957575840 |
Taxonomy | Alkaloids and derivatives > Tropane alkaloids |
IUPAC Name | [(1R,3S,5S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC2CC(C(C1)N2C)OC(=O)C |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@H]1C[C@@H]2C[C@H]([C@H](C1)N2C)OC(=O)C |
InChI | InChI=1S/C15H23NO4/c1-5-9(2)15(18)20-12-6-11-7-14(19-10(3)17)13(8-12)16(11)4/h5,11-14H,6-8H2,1-4H3/b9-5+/t11-,12+,13+,14-/m1/s1 |
InChI Key | JZEPGIHACXZLFL-NYKPPTNSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H23NO4 |
Molecular Weight | 281.35 g/mol |
Exact Mass | 281.16270821 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 2.10 |
3.beta.-Tigloyloxy-6.beta.-acetoxytropane |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.26% | 96.09% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.31% | 97.21% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.49% | 97.25% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.45% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 88.36% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.56% | 94.45% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 87.54% | 95.69% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.62% | 96.95% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 81.69% | 97.53% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 81.50% | 95.62% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 81.10% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Datura stramonium |
PubChem | 91750082 |
LOTUS | LTS0052418 |
wikiData | Q105137364 |