3beta-Phenylacetoxytropane
Internal ID | 2632566d-4842-4082-89ea-d287097c4020 |
Taxonomy | Alkaloids and derivatives > Tropane alkaloids |
IUPAC Name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylacetate |
SMILES (Canonical) | CN1C2CCC1CC(C2)OC(=O)CC3=CC=CC=C3 |
SMILES (Isomeric) | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)CC3=CC=CC=C3 |
InChI | InChI=1S/C16H21NO2/c1-17-13-7-8-14(17)11-15(10-13)19-16(18)9-12-5-3-2-4-6-12/h2-6,13-15H,7-11H2,1H3/t13-,14+,15? |
InChI Key | DCINQANYMBYYCH-YIONKMFJSA-N |
Popularity | 5 references in papers |
Molecular Formula | C16H21NO2 |
Molecular Weight | 259.34 g/mol |
Exact Mass | 259.157228913 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 2.90 |
3a-phenylacetoxytropane |
3.beta.-Phenylacetoxytropane |
SCHEMBL5791676 |
SCHEMBL13698870 |
DCINQANYMBYYCH-QDMKHBRRSA-N |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.60% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.74% | 98.95% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.19% | 94.62% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 93.14% | 94.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.27% | 90.17% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 88.14% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.10% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.72% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.65% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.15% | 99.17% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.11% | 94.08% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.41% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 80.64% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Atropa belladonna |
Datura stramonium |
Erythroxylum coca |
Erythroxylum hypericifolium |
Erythroxylum monogynum |
Erythroxylum zambesiacum |
PubChem | 11086474 |
LOTUS | LTS0163179 |
wikiData | Q104975410 |