3beta-Acetoxypregn-5-en-20beta-ol
Internal ID | fad1fd87-99e3-4853-9668-3ec26ac239bf |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CC(C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C)C)C)O |
SMILES (Isomeric) | C[C@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OC(=O)C)C)C)O |
InChI | InChI=1S/C23H36O3/c1-14(24)19-7-8-20-18-6-5-16-13-17(26-15(2)25)9-11-22(16,3)21(18)10-12-23(19,20)4/h5,14,17-21,24H,6-13H2,1-4H3/t14-,17+,18+,19-,20+,21+,22+,23-/m1/s1 |
InChI Key | KXWWWRVUYQUXMN-ZLTRAVGQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H36O3 |
Molecular Weight | 360.50 g/mol |
Exact Mass | 360.26644501 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.90 |
3beta-acetoxypregn-5-en-20beta-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.74% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.60% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.12% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 94.72% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.24% | 91.11% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.76% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.64% | 100.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.95% | 94.08% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.81% | 91.19% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.53% | 93.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.10% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.56% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.02% | 93.04% |
CHEMBL5028 | O14672 | ADAM10 | 81.96% | 97.50% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.87% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.99% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.53% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.46% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 11783365 |
LOTUS | LTS0115824 |
wikiData | Q105147574 |