5-Hydroxy-3-methoxy-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one
Internal ID | 7ad3c238-526e-487b-a68d-0ad4083be82a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-3-methoxy-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC)C4=CC(=C(C(=C4)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC)C4=CC(=C(C(=C4)O)O)O)O)O)O)O |
InChI | InChI=1S/C22H22O12/c1-7-15(26)18(29)19(30)22(32-7)33-9-5-10(23)14-13(6-9)34-20(21(31-2)17(14)28)8-3-11(24)16(27)12(25)4-8/h3-7,15,18-19,22-27,29-30H,1-2H3 |
InChI Key | LRKFQPXWFNUAOK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O12 |
Molecular Weight | 478.40 g/mol |
Exact Mass | 478.11112613 g/mol |
Topological Polar Surface Area (TPSA) | 196.00 Ų |
XlogP | 0.80 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.80% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.75% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.68% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.60% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.95% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.30% | 85.14% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.30% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.96% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.37% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.95% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.88% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.78% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.33% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 84.98% | 90.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.51% | 90.71% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.48% | 94.42% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.67% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.11% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.53% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dacrycarpus dacrydioides |
PubChem | 74978436 |
LOTUS | LTS0098124 |
wikiData | Q105156168 |