[(1S,2S,8S,9R,10S,11R,12S,15R)-10,15-diacetyloxy-9-hydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate
Internal ID | 879d79c1-3b4e-4377-97e5-9bd6e8030953 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | [(1S,2S,8S,9R,10S,11R,12S,15R)-10,15-diacetyloxy-9-hydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1(CCC(C23C1C(C(C45C2CCC(C4)C(=C)C5=O)(OC3)O)OC(=O)C)OC(=O)C)C |
SMILES (Isomeric) | CC(=O)OC[C@]1(CC[C@H]([C@]23[C@@H]1[C@@H]([C@@]([C@]45[C@H]2CCC(C4)C(=C)C5=O)(OC3)O)OC(=O)C)OC(=O)C)C |
InChI | InChI=1S/C26H34O9/c1-13-17-6-7-18-24-12-33-26(31,25(18,10-17)21(13)30)22(35-16(4)29)20(24)23(5,11-32-14(2)27)9-8-19(24)34-15(3)28/h17-20,22,31H,1,6-12H2,2-5H3/t17?,18-,19+,20+,22-,23+,24+,25-,26-/m0/s1 |
InChI Key | NETLVPWZRKTNPY-CXVKUEKLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H34O9 |
Molecular Weight | 490.50 g/mol |
Exact Mass | 490.22028266 g/mol |
Topological Polar Surface Area (TPSA) | 125.00 Ų |
XlogP | 1.70 |
Q27138714 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.19% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.44% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.00% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.70% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.39% | 97.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.37% | 96.38% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.81% | 82.69% |
CHEMBL2581 | P07339 | Cathepsin D | 88.67% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.64% | 94.75% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.89% | 90.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.11% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.74% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.57% | 95.89% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.53% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.19% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.70% | 93.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.43% | 95.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.40% | 97.28% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.49% | 92.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.20% | 92.62% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.15% | 94.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.00% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.89% | 91.07% |
CHEMBL5028 | O14672 | ADAM10 | 80.64% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon eriocalyx |
PubChem | 139031634 |
LOTUS | LTS0127037 |
wikiData | Q27138714 |