(4,10-Dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 2-methylpropanoate
| Internal ID | 966ffd4c-7f52-48d5-b629-5de2e80e9e7d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
| IUPAC Name | (4,10-dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 2-methylpropanoate |
| SMILES (Canonical) | CC1CCCC(C(C2C(C(C1=O)O)C(=C)C(=O)O2)OC(=O)C(C)C)(C)O |
| SMILES (Isomeric) | CC1CCCC(C(C2C(C(C1=O)O)C(=C)C(=O)O2)OC(=O)C(C)C)(C)O |
| InChI | InChI=1S/C19H28O7/c1-9(2)17(22)26-16-15-12(11(4)18(23)25-15)14(21)13(20)10(3)7-6-8-19(16,5)24/h9-10,12,14-16,21,24H,4,6-8H2,1-3,5H3 |
| InChI Key | FVCOWQVZIVEGLE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 110.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
![2D Structure of (4,10-Dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/3b8ea780-838a-11ee-9d0e-8f92425adbfd.jpg "2D Structure of (4,10-Dihydroxy-6,10-dimethyl-3-methylidene-2,5-dioxo-3a,4,6,7,8,9,11,11a-octahydrocyclodeca[b]furan-11-yl) 2-methylpropanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.22% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.85% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.12% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.96% | 90.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.88% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.14% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.46% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.37% | 91.19% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.85% | 93.03% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.85% | 91.07% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.45% | 83.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.81% | 92.62% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.79% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.14% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.47% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.16% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.70% | 89.63% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.63% | 98.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.30% | 95.50% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.34% | 95.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.29% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dittrichia viscosa |
| PubChem | 162997407 |
| LOTUS | LTS0038582 |
| wikiData | Q105002265 |