(2R,4aS,4bR,6aR,8R,9R,10aR,10bR,12R)-9,12-dihydroxy-2-[(2R,3R)-2-hydroxy-3-methyl-4-oxopentyl]-4a,4b,7,7,10a-pentamethyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5,6,6a,8,9,10,10b,11,12-decahydro-3H-chrysene-2-carboxylic acid
Internal ID | 8a22777f-ea67-4914-89de-2ba5594a0789 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | (2R,4aS,4bR,6aR,8R,9R,10aR,10bR,12R)-9,12-dihydroxy-2-[(2R,3R)-2-hydroxy-3-methyl-4-oxopentyl]-4a,4b,7,7,10a-pentamethyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5,6,6a,8,9,10,10b,11,12-decahydro-3H-chrysene-2-carboxylic acid |
SMILES (Canonical) | CC(C(CC1(CCC2(C(=C1)C(CC3C2(CCC4C3(CC(C(C4(C)C)OC5C(C(C(C(O5)CO)O)O)O)O)C)C)O)C)C(=O)O)O)C(=O)C |
SMILES (Isomeric) | C[C@H]([C@@H](C[C@@]1(CC[C@@]2(C(=C1)[C@@H](C[C@H]3[C@]2(CC[C@@H]4[C@@]3(C[C@H]([C@@H](C4(C)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)C)C)O)C)C(=O)O)O)C(=O)C |
InChI | InChI=1S/C36H58O12/c1-17(18(2)38)21(40)15-36(31(45)46)11-10-34(6)19(13-36)20(39)12-25-33(5)14-22(41)29(32(3,4)24(33)8-9-35(25,34)7)48-30-28(44)27(43)26(42)23(16-37)47-30/h13,17,20-30,37,39-44H,8-12,14-16H2,1-7H3,(H,45,46)/t17-,20+,21+,22+,23+,24-,25+,26+,27-,28+,29-,30-,33-,34+,35+,36-/m0/s1 |
InChI Key | GDGOHQANLRANAK-QQBCWDLESA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H58O12 |
Molecular Weight | 682.80 g/mol |
Exact Mass | 682.39282728 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of (2R,4aS,4bR,6aR,8R,9R,10aR,10bR,12R)-9,12-dihydroxy-2-[(2R,3R)-2-hydroxy-3-methyl-4-oxopentyl]-4a,4b,7,7,10a-pentamethyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5,6,6a,8,9,10,10b,11,12-decahydro-3H-chrysene-2-carboxylic acid 2D Structure of (2R,4aS,4bR,6aR,8R,9R,10aR,10bR,12R)-9,12-dihydroxy-2-[(2R,3R)-2-hydroxy-3-methyl-4-oxopentyl]-4a,4b,7,7,10a-pentamethyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,5,6,6a,8,9,10,10b,11,12-decahydro-3H-chrysene-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3b86b900-86e1-11ee-88e3-179670a3691b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.91% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.16% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.82% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.49% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.99% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.21% | 97.25% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.59% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.12% | 95.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.61% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.25% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.14% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.84% | 95.56% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.76% | 98.10% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.70% | 100.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.48% | 92.78% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.43% | 93.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.38% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.80% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.70% | 97.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.70% | 90.17% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.41% | 91.24% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.05% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Elsholtzia bodinieri |
PubChem | 162917132 |
LOTUS | LTS0084718 |
wikiData | Q105006696 |