(3b,7b,22x)-Cucurbita-5,24-diene-3,7,23-triol 7-glucoside
Internal ID | 5000ecf6-099e-47b5-b504-c0ab2de6b915 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | 2-[[3-hydroxy-17-(4-hydroxy-6-methylhept-5-en-2-yl)-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC(CC(C=C(C)C)O)C1CCC2(C1(CCC3(C2C(C=C4C3CCC(C4(C)C)O)OC5C(C(C(C(O5)CO)O)O)O)C)C)C |
SMILES (Isomeric) | CC(CC(C=C(C)C)O)C1CCC2(C1(CCC3(C2C(C=C4C3CCC(C4(C)C)O)OC5C(C(C(C(O5)CO)O)O)O)C)C)C |
InChI | InChI=1S/C36H60O8/c1-19(2)15-21(38)16-20(3)22-11-12-36(8)31-25(43-32-30(42)29(41)28(40)26(18-37)44-32)17-24-23(9-10-27(39)33(24,4)5)34(31,6)13-14-35(22,36)7/h15,17,20-23,25-32,37-42H,9-14,16,18H2,1-8H3 |
InChI Key | POYBZOIHJHDZFP-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C36H60O8 |
Molecular Weight | 620.90 g/mol |
Exact Mass | 620.42881887 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 5.20 |
CHEBI:176253 |
2-[[3-hydroxy-17-(4-hydroxy-6-methylhept-5-en-2-yl)-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.05% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.45% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 93.68% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.25% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.83% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.34% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.64% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.08% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.56% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.41% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.50% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.40% | 93.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.98% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.44% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.75% | 99.17% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.73% | 92.32% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.57% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.48% | 96.21% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.27% | 97.79% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.09% | 90.17% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.00% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 14807326 |
LOTUS | LTS0153977 |
wikiData | Q105212748 |