(E,12S)-N-[(2R,3S,4S,5R,6S)-2-[(2R,3R,4R,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R)-2-[(2S,3S,4R,5S)-5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-4,5-dihydroxyoxan-3-yl]-12-methyltetradec-2-enamide
| Internal ID | fd4991f4-7666-4f10-8b47-1f5d857f5703 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Aminosaccharides > N-acyl-alpha-hexosamines |
| IUPAC Name | (E,12S)-N-[(2R,3S,4S,5R,6S)-2-[(2R,3R,4R,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R)-2-[(2S,3S,4R,5S)-5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-4,5-dihydroxyoxan-3-yl]-12-methyltetradec-2-enamide |
| SMILES (Canonical) | CCC(C)CCCCCCCCC=CC(=O)NC1C(C(C(OC1OC2C(C(C(C(O2)CO)O)O)NC(=O)C)CC(C3C(C(C(O3)N4CCC(=O)NC4=O)O)O)O)O)O |
| SMILES (Isomeric) | CC[C@H](C)CCCCCCCC/C=C/C(=O)N[C@H]1[C@@H]([C@H]([C@@H](O[C@@H]1O[C@@H]2[C@@H]([C@H]([C@H]([C@@H](O2)CO)O)O)NC(=O)C)C[C@H]([C@H]3[C@H]([C@H]([C@H](O3)N4CCC(=O)NC4=O)O)O)O)O)O |
| InChI | InChI=1S/C38H64N4O16/c1-4-19(2)13-11-9-7-5-6-8-10-12-14-24(46)40-27-31(51)28(48)22(55-37(27)58-36-26(39-20(3)44)30(50)29(49)23(18-43)56-36)17-21(45)34-32(52)33(53)35(57-34)42-16-15-25(47)41-38(42)54/h12,14,19,21-23,26-37,43,45,48-53H,4-11,13,15-18H2,1-3H3,(H,39,44)(H,40,46)(H,41,47,54)/b14-12+/t19-,21+,22-,23-,26+,27-,28-,29-,30+,31-,32-,33+,34-,35-,36+,37+/m0/s1 |
| InChI Key | LDJOYEHYNQBOME-IRJITCRSSA-N |
| Popularity | 13 references in papers |
| Molecular Formula | C38H64N4O16 |
| Molecular Weight | 832.90 g/mol |
| Exact Mass | 832.43173197 g/mol |
| Topological Polar Surface Area (TPSA) | 306.00 Ų |
| XlogP | 0.10 |
| RefChem:932284 |
| 51330-34-8 |
| CHEBI:223977 |
| (E,12S)-N-[(2R,3S,4S,5R,6S)-2-[(2R,3R,4R,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R)-2-[(2S,3S,4R,5S)-5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-4,5-dihydroxyoxan-3-yl]-12-methyltetradec-2-enamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.37% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.91% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.88% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.16% | 94.66% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.33% | 85.14% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.29% | 96.38% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.35% | 95.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.25% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.97% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.31% | 97.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.95% | 90.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.20% | 93.56% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.52% | 92.86% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.44% | 94.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.01% | 90.71% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.94% | 92.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.11% | 94.33% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.90% | 95.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.48% | 95.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.31% | 98.59% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.97% | 95.89% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.87% | 95.83% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.74% | 100.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.69% | 89.50% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 84.48% | 92.12% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.23% | 91.24% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.48% | 96.47% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 83.26% | 92.97% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.66% | 100.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.63% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.19% | 95.89% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.57% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.60% | 96.90% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.04% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589178 |
| LOTUS | LTS0190504 |
| wikiData | Q105150245 |