(3b,20R,22R)-3,20,27-Trihydroxy-1-oxowitha-5,24-dienolide 3-glucoside
Internal ID | 681150af-053e-4d35-aaaa-ec917c2fea98 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives > Withanolide glycosides and derivatives |
IUPAC Name | 2-[1-[10,13-dimethyl-1-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxyethyl]-5-(hydroxymethyl)-4-methyl-2,3-dihydropyran-6-one |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC=C5C4(C(=O)CC(C5)OC6C(C(C(C(O6)CO)O)O)O)C)C)O)CO |
SMILES (Isomeric) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC=C5C4(C(=O)CC(C5)OC6C(C(C(C(O6)CO)O)O)O)C)C)O)CO |
InChI | InChI=1S/C34H50O11/c1-16-11-26(45-30(41)20(16)14-35)34(4,42)24-8-7-21-19-6-5-17-12-18(43-31-29(40)28(39)27(38)23(15-36)44-31)13-25(37)33(17,3)22(19)9-10-32(21,24)2/h5,18-19,21-24,26-29,31,35-36,38-40,42H,6-15H2,1-4H3 |
InChI Key | OJRQAQMTUKIJMK-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C34H50O11 |
Molecular Weight | 634.80 g/mol |
Exact Mass | 634.33531241 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | 1.40 |
CHEBI:169206 |
2-[1-[10,13-dimethyl-1-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxyethyl]-5-(hydroxymethyl)-4-methyl-2,3-dihydropyran-6-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.85% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.59% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.10% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.28% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.61% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.54% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.02% | 98.95% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.83% | 90.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.92% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.62% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.86% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.17% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.68% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.93% | 85.14% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.55% | 93.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.18% | 93.04% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.86% | 92.97% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.40% | 97.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.08% | 97.36% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.73% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.71% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.63% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.74% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.71% | 99.17% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.64% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis peruviana |
PubChem | 73108380 |
LOTUS | LTS0150920 |
wikiData | Q105193238 |