3alpha-Hydroxyolean-11,13(18)-dien-28-oic acid
Internal ID | 88f463c5-4df8-4cc1-9a11-39a3127b6ddb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4aS,6aR,6aS,6bR,8aR,10R,12aS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=C2C1)C=CC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C)C(=O)O)C |
SMILES (Isomeric) | C[C@]12CC[C@H](C([C@@H]1CC[C@@]3([C@@H]2C=CC4=C5CC(CC[C@@]5(CC[C@]43C)C(=O)O)(C)C)C)(C)C)O |
InChI | InChI=1S/C30H46O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8-9,21-23,31H,10-18H2,1-7H3,(H,32,33)/t21-,22+,23+,27-,28+,29+,30-/m0/s1 |
InChI Key | XMOMYSSKYVFTKO-LNVXMQETSA-N |
Popularity | 3 references in papers |
Molecular Formula | C30H46O3 |
Molecular Weight | 454.70 g/mol |
Exact Mass | 454.34469533 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 7.00 |
3alpha-hydroxyolean-11,13(18)-dien-28-oic acid |
CHEMBL486582 |
Q27137562 |
(3alpha)-3-hydroxyoleana-11,13(18)-dien-28-oic acid |
(4aS,6aR,6aS,6bR,8aR,10R,12aS)-10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.27% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.46% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.31% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 89.10% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.01% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.33% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.39% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.35% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.12% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 80.68% | 97.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.15% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fatsia polycarpa |
Mulguraea tridens |
PubChem | 10766159 |
LOTUS | LTS0031516 |
wikiData | Q27137562 |