2-(5a,5b,8,8,11a,13b-Hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl)propan-2-ol
Internal ID | 9b604042-54fc-4bb7-af85-04259f1a60cb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Hopanoids |
IUPAC Name | 2-(5a,5b,8,8,11a,13b-hexamethyl-1,2,3,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-hexadecahydrocyclopenta[a]chrysen-3-yl)propan-2-ol |
SMILES (Canonical) | CC1(CCCC2(C1CCC3(C2CCC4C3(CCC5C4(CCC5C(C)(C)O)C)C)C)C)C |
SMILES (Isomeric) | CC1(CCCC2(C1CCC3(C2CCC4C3(CCC5C4(CCC5C(C)(C)O)C)C)C)C)C |
InChI | InChI=1S/C30H52O/c1-25(2)15-9-16-28(6)22(25)14-19-30(8)24(28)11-10-23-27(5)17-12-20(26(3,4)31)21(27)13-18-29(23,30)7/h20-24,31H,9-19H2,1-8H3 |
InChI Key | PNJBOAVCVAVRGR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H52O |
Molecular Weight | 428.70 g/mol |
Exact Mass | 428.401816278 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.21% | 97.25% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.40% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.04% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.92% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.41% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.30% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.99% | 93.04% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.74% | 96.43% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.45% | 96.61% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.44% | 96.09% |
CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 82.91% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.18% | 98.95% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.14% | 91.03% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.20% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.57% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adiantum edgeworthii |
Cheiropleuria bicuspis |
Conocephalum japonicum |
Fossombronia alaskana |
Lepisorus contortus |
Lophosoria quadripinnata |
Plagiochasma rupestre |
Polypodium virginianum |
PubChem | 5245211 |
LOTUS | LTS0051971 |
wikiData | Q105211979 |