3a,6-Dimethyl-1-(6-methylhepta-2,5-dien-2-yl)-1,2,3,4,6,7,8,8a-octahydroazulen-5-one
Internal ID | d5272fd1-ba98-414c-94f4-3df628274b04 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Sphenolobane diterpenoids |
IUPAC Name | 3a,6-dimethyl-1-(6-methylhepta-2,5-dien-2-yl)-1,2,3,4,6,7,8,8a-octahydroazulen-5-one |
SMILES (Canonical) | CC1CCC2C(CCC2(CC1=O)C)C(=CCC=C(C)C)C |
SMILES (Isomeric) | CC1CCC2C(CCC2(CC1=O)C)C(=CCC=C(C)C)C |
InChI | InChI=1S/C20H32O/c1-14(2)7-6-8-15(3)17-11-12-20(5)13-19(21)16(4)9-10-18(17)20/h7-8,16-18H,6,9-13H2,1-5H3 |
InChI Key | UGBNGEGMTBRTSC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H32O |
Molecular Weight | 288.50 g/mol |
Exact Mass | 288.245315640 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 6.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.89% | 83.82% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.42% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.06% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 90.72% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.27% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.63% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.00% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.81% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.77% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.54% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.37% | 92.94% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.88% | 97.05% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.53% | 93.04% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.51% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.49% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.14% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anastrophyllum donnianum |
PubChem | 162972117 |
LOTUS | LTS0210277 |
wikiData | Q105272243 |