[(3aS,5aR,6R,9aS,9bS)-5a-methyl-3-methylidene-2-oxo-9-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,6,7,8,9,9a,9b-octahydro-3aH-benzo[g][1]benzofuran-6-yl] 2-hydroxy-3-(4-hydroxyphenyl)propanoate
Internal ID | 94f51372-83ee-4dd2-bd68-c826bbe19325 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Eudesmanolides, secoeudesmanolides, and derivatives |
IUPAC Name | [(3aS,5aR,6R,9aS,9bS)-5a-methyl-3-methylidene-2-oxo-9-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,6,7,8,9,9a,9b-octahydro-3aH-benzo[g][1]benzofuran-6-yl] 2-hydroxy-3-(4-hydroxyphenyl)propanoate |
SMILES (Canonical) | CC12CCC3C(C1C(CCC2OC(=O)C(CC4=CC=C(C=C4)O)O)COC5C(C(C(C(O5)CO)O)O)O)OC(=O)C3=C |
SMILES (Isomeric) | C[C@@]12CC[C@@H]3[C@@H]([C@H]1C(CC[C@H]2OC(=O)C(CC4=CC=C(C=C4)O)O)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)OC(=O)C3=C |
InChI | InChI=1S/C30H40O12/c1-14-18-9-10-30(2)21(41-28(38)19(33)11-15-3-6-17(32)7-4-15)8-5-16(22(30)26(18)42-27(14)37)13-39-29-25(36)24(35)23(34)20(12-31)40-29/h3-4,6-7,16,18-26,29,31-36H,1,5,8-13H2,2H3/t16?,18-,19?,20+,21+,22+,23+,24-,25+,26-,29+,30-/m0/s1 |
InChI Key | YQSLXBBQBWWTOW-ZJFCZWDDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H40O12 |
Molecular Weight | 592.60 g/mol |
Exact Mass | 592.25197671 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 1.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.05% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.00% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.35% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.21% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.39% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.24% | 85.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.78% | 96.61% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.09% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.79% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.71% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.30% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.21% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.80% | 89.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.13% | 94.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.56% | 99.17% |
CHEMBL268 | P43235 | Cathepsin K | 84.26% | 96.85% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.15% | 95.83% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.78% | 96.37% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.54% | 95.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.04% | 92.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.64% | 97.14% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.62% | 94.97% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ixeris repens |
PubChem | 101589324 |
LOTUS | LTS0205323 |
wikiData | Q105352561 |