(2R,3S,4R,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(3,4,5-trimethoxyphenyl)methyl]oxane-3,4,5-triol
| Internal ID | dd712a14-164a-4090-b37f-1ed94767bdbe |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(3,4,5-trimethoxyphenyl)methyl]oxane-3,4,5-triol |
| SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)CC2C(C(C(C(O2)COC3C(C(CO3)(CO)O)O)O)O)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)C[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@](CO3)(CO)O)O)O)O)O |
| InChI | InChI=1S/C21H32O12/c1-28-12-5-10(6-13(29-2)18(12)30-3)4-11-15(23)17(25)16(24)14(33-11)7-31-20-19(26)21(27,8-22)9-32-20/h5-6,11,14-17,19-20,22-27H,4,7-9H2,1-3H3/t11-,14+,15-,16+,17+,19-,20+,21+/m0/s1 |
| InChI Key | ZEJKLTXPDGZDBD-XFRIDPOZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H32O12 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.18937645 g/mol |
| Topological Polar Surface Area (TPSA) | 177.00 Ų |
| XlogP | -1.90 |
| There are no found synonyms. |
![2D Structure of (2R,3S,4R,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(3,4,5-trimethoxyphenyl)methyl]oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/3a36eaf0-8638-11ee-854f-6fef65cd1fb0.jpg "2D Structure of (2R,3S,4R,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(3,4,5-trimethoxyphenyl)methyl]oxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.23% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.90% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.66% | 95.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.12% | 94.45% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 91.73% | 92.98% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.04% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.81% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.80% | 95.89% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.58% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.54% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.90% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.61% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.77% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.69% | 95.89% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.99% | 93.18% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.18% | 89.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.57% | 96.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.37% | 96.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.25% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.92% | 92.94% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 80.43% | 95.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nauclea orientalis |
| PubChem | 163053204 |
| LOTUS | LTS0103713 |
| wikiData | Q105373326 |