2-[(4R,5S,7R,8S,11S,12S,20S)-16,17,20-trihydroxy-7-(hydroxymethyl)-2,10,13-trioxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,14-tetraoxatetracyclo[10.6.1.14,8.015,19]icosa-1(18),15(19),16-trien-11-yl]acetic acid
Internal ID | 8a0cf3cb-fac8-453d-a70f-5ad06ab44757 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[(4R,5S,7R,8S,11S,12S,20S)-16,17,20-trihydroxy-7-(hydroxymethyl)-2,10,13-trioxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,14-tetraoxatetracyclo[10.6.1.14,8.015,19]icosa-1(18),15(19),16-trien-11-yl]acetic acid |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2C3C(C(C(O2)CO)OC(=O)C(C4C5=C(C(=C(C=C5C(=O)O3)O)O)OC4=O)CC(=O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)O[C@H]2[C@H]3[C@H]([C@@H]([C@H](O2)CO)OC(=O)[C@H]([C@H]4C5=C(C(=C(C=C5C(=O)O3)O)O)OC4=O)CC(=O)O)O |
InChI | InChI=1S/C26H22O18/c27-5-12-19-18(35)21(26(40-12)44-22(36)6-1-9(28)16(33)10(29)2-6)43-23(37)7-3-11(30)17(34)20-14(7)15(25(39)42-20)8(4-13(31)32)24(38)41-19/h1-3,8,12,15,18-19,21,26-30,33-35H,4-5H2,(H,31,32)/t8-,12+,15-,18-,19+,21+,26-/m0/s1 |
InChI Key | FUFSTUTVLLDTGB-XFGNAUIJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H22O18 |
Molecular Weight | 622.40 g/mol |
Exact Mass | 622.08061385 g/mol |
Topological Polar Surface Area (TPSA) | 293.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of 2-[(4R,5S,7R,8S,11S,12S,20S)-16,17,20-trihydroxy-7-(hydroxymethyl)-2,10,13-trioxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,14-tetraoxatetracyclo[10.6.1.14,8.015,19]icosa-1(18),15(19),16-trien-11-yl]acetic acid 2D Structure of 2-[(4R,5S,7R,8S,11S,12S,20S)-16,17,20-trihydroxy-7-(hydroxymethyl)-2,10,13-trioxo-5-(3,4,5-trihydroxybenzoyl)oxy-3,6,9,14-tetraoxatetracyclo[10.6.1.14,8.015,19]icosa-1(18),15(19),16-trien-11-yl]acetic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3a2b22a0-85e7-11ee-a0b1-b581162ab227.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.62% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.44% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.66% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.99% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.83% | 95.56% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.24% | 83.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.84% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.64% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 86.96% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.70% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.34% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.44% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.42% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.20% | 97.36% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.14% | 89.34% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.32% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pelargonium reniforme |
Phyllanthus virgatus |
PubChem | 162861175 |
LOTUS | LTS0115691 |
wikiData | Q105001672 |