(2S,3S,4S,5R,6R)-6-[[(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,21R,22R,23S)-2-acetyloxy-22-butanoyloxy-23-hydroxy-4,5,9,9,13,20,20-heptamethyl-21-[(Z)-2-methylbut-2-enoyl]oxy-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(1R,2R,3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyoxane-2-carboxylic acid
Internal ID | e4c72ee0-3c1a-4880-a35c-f5edb0ca0314 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(1R,2R,4S,5R,8R,10S,13R,14R,17S,18R,21R,22R,23S)-2-acetyloxy-22-butanoyloxy-23-hydroxy-4,5,9,9,13,20,20-heptamethyl-21-[(Z)-2-methylbut-2-enoyl]oxy-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(1R,2R,3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CCCC(=O)OC1C(C(CC2C13C(CC4(C2(CCC5C4(CCC6C5(CCC(C6(C)C)OC7C(C(C(C(O7)C(=O)O)O)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)O)O)O)O)OC1CC(C(C(C1O)O)O)CO)C)C)OC3O)C)OC(=O)C)(C)C)OC(=O)C(=CC)C |
SMILES (Isomeric) | CCCC(=O)O[C@H]1[C@@H](C(C[C@@H]2[C@@]13[C@@H](C[C@@]4([C@@]2(CC[C@H]5[C@]4(CC[C@@H]6[C@@]5(CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(=O)O)O)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)O)O)O)O)O[C@@H]1C[C@@H]([C@@H]([C@@H]([C@H]1O)O)O)CO)C)C)O[C@@H]3O)C)OC(=O)C)(C)C)OC(=O)/C(=C\C)/C |
InChI | InChI=1S/C65H102O29/c1-12-14-36(69)88-51-50(92-53(81)26(3)13-2)59(5,6)22-33-64-20-16-32-61(9)18-17-34(60(7,8)31(61)15-19-62(32,10)63(64,11)23-35(84-27(4)68)65(33,51)58(83)94-64)87-57-49(85-29-21-28(24-66)37(70)40(73)38(29)71)46(45(78)47(90-57)52(79)80)89-56-48(42(75)39(72)30(25-67)86-56)91-55-44(77)41(74)43(76)54(82)93-55/h13,28-35,37-51,54-58,66-67,70-78,82-83H,12,14-25H2,1-11H3,(H,79,80)/b26-13-/t28-,29-,30-,31+,32-,33+,34+,35-,37+,38+,39+,40+,41-,42+,43-,44-,45+,46+,47+,48-,49-,50+,51+,54-,55-,56+,57-,58+,61+,62-,63+,64+,65-/m1/s1 |
InChI Key | MWCZTRNYCQBDPZ-FDAHELBLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C65H102O29 |
Molecular Weight | 1347.50 g/mol |
Exact Mass | 1346.65067721 g/mol |
Topological Polar Surface Area (TPSA) | 453.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.29% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.06% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.43% | 94.45% |
CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 94.63% | 97.34% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.24% | 91.24% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.04% | 92.98% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.98% | 92.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.96% | 93.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.68% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.75% | 97.09% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 88.52% | 82.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.34% | 99.17% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 88.14% | 95.36% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.00% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.80% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.67% | 98.95% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.59% | 91.03% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.52% | 92.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.51% | 91.19% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 86.42% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.12% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.78% | 89.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.60% | 94.33% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.40% | 95.38% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.95% | 94.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.76% | 86.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.67% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.63% | 96.61% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.12% | 97.36% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.11% | 96.43% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.68% | 97.14% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.06% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.97% | 95.56% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 82.57% | 89.92% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.30% | 100.00% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.05% | 98.99% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.15% | 94.45% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.73% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Maesa lanceolata |
PubChem | 163191840 |
LOTUS | LTS0081002 |
wikiData | Q105173513 |