[(E,6R)-6-[(2S,8S,9R,10S,13R,14S,16R,17R)-2,16-dihydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl] acetate
Internal ID | aa5f446e-f1ca-46a3-9381-7e2f34d6da2b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | [(E,6R)-6-[(2S,8S,9R,10S,13R,14S,16R,17R)-2,16-dihydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl] acetate |
SMILES (Canonical) | CC(=O)OC(C)(C)C=CC(=O)C(C)(C1C(CC2(C1(CC(=O)C3(C2CC=C4C3CC(C(=O)C4(C)C)O)C)C)C)O)O |
SMILES (Isomeric) | CC(=O)OC(C)(C)/C=C/C(=O)[C@@](C)([C@H]1[C@@H](C[C@@]2([C@@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@@H]3C[C@@H](C(=O)C4(C)C)O)C)C)C)O)O |
InChI | InChI=1S/C32H46O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,12-13,19-22,25,34-35,39H,11,14-16H2,1-9H3/b13-12+/t19-,20-,21+,22-,25-,29-,30+,31-,32-/m0/s1 |
InChI Key | IXQKXEUSCPEQRD-QATBOUOLSA-N |
Popularity | 19 references in papers |
Molecular Formula | C32H46O8 |
Molecular Weight | 558.70 g/mol |
Exact Mass | 558.31926842 g/mol |
Topological Polar Surface Area (TPSA) | 138.00 Ų |
XlogP | 2.60 |
CHEMBL507237 |
REGID_for_CID_15944763 |
BDBM50378060 |
SMR000232280 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5514 | P42858 | Huntingtin |
22387.2 nM |
Potency |
PMID: 22085418
|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
270 nM |
IC50 |
via Super-PRED
|
CHEMBL1803 | P20701 | Leukocyte adhesion glycoprotein LFA-1 alpha |
300 nM |
IC50 |
PMID: 12088430
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
22387.2 nM |
Potency |
PMID: 16989518
|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
316.2 nM 316.2 nM |
Potency Potency |
PMID: 11520237
via Super-PRED |
CHEMBL1293235 | P02545 | Prelamin-A/C |
199.5 nM 199.5 nM |
Potency Potency |
via Super-PRED
PMID: 3430171 |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
316.2 nM 316.2 nM |
Potency Potency |
via Super-PRED
PMID: 22620987 |
CHEMBL3797 | Q13315 | Serine-protein kinase ATM |
19952.6 nM |
Potency |
PMID: 20025236
|
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 |
3000 nM |
IC50 |
PMID: 20524638
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
11220.2 nM |
Potency |
PMID: 12137465
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.58% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.02% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.83% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.69% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.15% | 96.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.05% | 97.09% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 90.42% | 97.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.38% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.54% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.76% | 95.56% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.79% | 89.34% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.55% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.47% | 97.25% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.37% | 91.07% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.64% | 82.69% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.16% | 97.21% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.07% | 91.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.89% | 99.23% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.77% | 96.39% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.32% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cucumis melo |
PubChem | 15944763 |
NPASS | NPC475524 |
ChEMBL | CHEMBL507237 |
LOTUS | LTS0236615 |
wikiData | Q105122415 |