(1R,2S,3S,4S,5S,6S,8R,9S,10S,13R,16S,17R,18S)-11-ethyl-6,16,18-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,4,8,9-tetrol
| Internal ID | 219a453a-d487-4443-a4ea-debc55982598 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
| IUPAC Name | (1R,2S,3S,4S,5S,6S,8R,9S,10S,13R,16S,17R,18S)-11-ethyl-6,16,18-trimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,4,8,9-tetrol |
| SMILES (Canonical) | CCN1CC2(CCC(C34C2C(C(C31)(C5(CC(C6CC4(C5C6O)O)OC)O)O)OC)OC)C |
| SMILES (Isomeric) | CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@@H]([C@@]([C@H]31)([C@]5(C[C@@H]([C@H]6C[C@@]4([C@@H]5[C@H]6O)O)OC)O)O)OC)OC)C |
| InChI | InChI=1S/C24H39NO7/c1-6-25-11-20(2)8-7-14(31-4)23-17(20)18(32-5)24(29,19(23)25)22(28)10-13(30-3)12-9-21(23,27)16(22)15(12)26/h12-19,26-29H,6-11H2,1-5H3/t12-,13+,14+,15+,16+,17-,18+,19+,20+,21+,22-,23-,24-/m1/s1 |
| InChI Key | ITRMYNYWNDISSP-LRGMBMJUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H39NO7 |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.27265258 g/mol |
| Topological Polar Surface Area (TPSA) | 112.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.80% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.56% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.32% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.06% | 97.09% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.37% | 91.03% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.35% | 95.36% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.17% | 95.89% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.93% | 89.05% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.33% | 97.28% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.33% | 97.14% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.16% | 89.62% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.87% | 92.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.59% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.07% | 98.95% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.00% | 95.58% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.85% | 96.77% |
| CHEMBL204 | P00734 | Thrombin | 82.95% | 96.01% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.20% | 96.38% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 81.92% | 94.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.05% | 100.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.93% | 96.43% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.93% | 97.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.37% | 93.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.36% | 92.94% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 80.07% | 98.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101232079 |
| LOTUS | LTS0169962 |
| wikiData | Q105120252 |