[(11R,13Z,14R,16R,18S)-13-ethylidene-11-methyl-1-aza-11-azoniapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6,8(17)-tetraen-18-yl]methanol
| Internal ID | 8153864f-b99e-4ad7-a56b-cb3dc47ba316 |
| Taxonomy | Alkaloids and derivatives > Pleiocarpaman alkaloids |
| IUPAC Name | [(11R,13Z,14R,16R,18S)-13-ethylidene-11-methyl-1-aza-11-azoniapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6,8(17)-tetraen-18-yl]methanol |
| SMILES (Canonical) | CC=C1C[N+]2(CCC3=C4C2CC1C(N4C5=CC=CC=C35)CO)C |
| SMILES (Isomeric) | C/C=C/1\C[N@+]2(CCC3=C4[C@H]2C[C@H]1[C@H](N4C5=CC=CC=C35)CO)C |
| InChI | InChI=1S/C20H25N2O/c1-3-13-11-22(2)9-8-15-14-6-4-5-7-17(14)21-18(12-23)16(13)10-19(22)20(15)21/h3-7,16,18-19,23H,8-12H2,1-2H3/q+1/b13-3+/t16-,18-,19-,22-/m1/s1 |
| InChI Key | HFLUPWJGJPYITM-WSWYGYGVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H25N2O+ |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.196688425 g/mol |
| Topological Polar Surface Area (TPSA) | 25.20 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
![2D Structure of [(11R,13Z,14R,16R,18S)-13-ethylidene-11-methyl-1-aza-11-azoniapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6,8(17)-tetraen-18-yl]methanol](https://plantaedb.com/storage/docs/compounds/2023/11/39124170-85ca-11ee-b330-5193d596d6fd.jpg "2D Structure of [(11R,13Z,14R,16R,18S)-13-ethylidene-11-methyl-1-aza-11-azoniapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6,8(17)-tetraen-18-yl]methanol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.83% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.82% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.75% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.08% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.08% | 97.09% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 89.65% | 94.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.57% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.29% | 86.33% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.65% | 95.83% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.60% | 89.00% |
| CHEMBL228 | P31645 | Serotonin transporter | 82.02% | 95.51% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.75% | 94.62% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.66% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Strychnos guianensis |
| PubChem | 163184340 |
| LOTUS | LTS0127658 |
| wikiData | Q105027388 |