3,9,10-trimethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol
| Internal ID | 6ee6bc17-3d92-4cf5-96c4-d50c922d9902 |
| Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
| IUPAC Name | 3,9,10-trimethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
| SMILES (Canonical) | COC1=C(C2=C(C=C1)C=C3C4=CC(=C(C=C4CCN3C2)OC)O)OC |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1)C=C3C4=CC(=C(C=C4CCN3C2)OC)O)OC |
| InChI | InChI=1S/C20H21NO4/c1-23-18-5-4-12-8-16-14-10-17(22)19(24-2)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,8-10,22H,6-7,11H2,1-3H3 |
| InChI Key | CYOURJWVXZHEPP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of 3,9,10-trimethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/3910-trimethoxy-68-dihydro-5h-isoquinolino21-bisoquinolin-2-ol.jpg "2D Structure of 3,9,10-trimethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.50% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.89% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.75% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.59% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.43% | 93.40% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.28% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.60% | 98.95% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 92.18% | 95.12% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.60% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.56% | 90.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.59% | 91.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.11% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.10% | 95.89% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 86.96% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.06% | 94.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.64% | 89.62% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.55% | 85.14% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 82.29% | 95.62% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.22% | 82.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Thalictrum foliolosum |
| PubChem | 162867762 |
| LOTUS | LTS0076853 |
| wikiData | Q104972451 |