6-[[8a-Carboxy-4-(hydroxymethyl)-4,6a,6b,14b-tetramethyl-11-methylidene-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid
Internal ID | 4bab812e-6c9e-4d12-ac09-0fe7e0cf1acc |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives |
IUPAC Name | 6-[[8a-carboxy-4-(hydroxymethyl)-4,6a,6b,14b-tetramethyl-11-methylidene-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC12CCC(C(C1CCC3(C2CC=C4C3(CCC5(C4CC(=C)CC5)C(=O)O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)O)O)O |
SMILES (Isomeric) | CC12CCC(C(C1CCC3(C2CC=C4C3(CCC5(C4CC(=C)CC5)C(=O)O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)O)O)O |
InChI | InChI=1S/C35H52O10/c1-18-8-13-35(30(42)43)15-14-33(4)19(20(35)16-18)6-7-22-31(2)11-10-23(32(3,17-36)21(31)9-12-34(22,33)5)44-29-26(39)24(37)25(38)27(45-29)28(40)41/h6,20-27,29,36-39H,1,7-17H2,2-5H3,(H,40,41)(H,42,43) |
InChI Key | KNHPRHYWTLFZED-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H52O10 |
Molecular Weight | 632.80 g/mol |
Exact Mass | 632.35604785 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 3.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.44% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.94% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.53% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.31% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.97% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.50% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 85.58% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.57% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.53% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 84.45% | 97.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.63% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.38% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.11% | 91.07% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.64% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.38% | 97.36% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.68% | 93.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.86% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anredera baselloides |
PubChem | 14888776 |
LOTUS | LTS0002071 |
wikiData | Q105143418 |