(1R,13R)-6-acetyl-13-hydroxy-16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaen-12-one
Internal ID | 89f68454-32c3-4660-b11f-0e8c0cab3a27 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Rotenoids > Rotenones |
IUPAC Name | (1R,13R)-6-acetyl-13-hydroxy-16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaen-12-one |
SMILES (Canonical) | CC(=O)C1=CC2=C(O1)C=CC3=C2OC4COC5=CC(=C(C=C5C4(C3=O)O)OC)OC |
SMILES (Isomeric) | CC(=O)C1=CC2=C(O1)C=CC3=C2O[C@@H]4COC5=CC(=C(C=C5[C@@]4(C3=O)O)OC)OC |
InChI | InChI=1S/C22H18O8/c1-10(23)15-6-12-14(29-15)5-4-11-20(12)30-19-9-28-16-8-18(27-3)17(26-2)7-13(16)22(19,25)21(11)24/h4-8,19,25H,9H2,1-3H3/t19-,22-/m1/s1 |
InChI Key | FWTDRWPXOUFZKQ-DENIHFKCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H18O8 |
Molecular Weight | 410.40 g/mol |
Exact Mass | 410.10016753 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of (1R,13R)-6-acetyl-13-hydroxy-16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaen-12-one 2D Structure of (1R,13R)-6-acetyl-13-hydroxy-16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaen-12-one](https://plantaedb.com/storage/docs/compounds/2023/07/38b7b350-24bf-11ee-a069-d524320f0375.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.57% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.51% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.90% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.81% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 90.80% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.71% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.91% | 91.19% |
CHEMBL2535 | P11166 | Glucose transporter | 89.46% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.29% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.87% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.48% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.17% | 95.56% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.29% | 89.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.98% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.89% | 97.09% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.52% | 90.24% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.86% | 92.62% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.00% | 94.80% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.68% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.89% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.52% | 99.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.43% | 96.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.02% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea cretica |
Ageratina riparia |
Cordia americana |
Glycosmis lanceolata |
Pedicularis semitorta |
Scopolia japonica |