(4S,7S,10R,11R)-7,11-dimethyl-4-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(15),5,13(16)-triene-7,10,11-triol
Internal ID | eebe995e-e23d-47cc-a6ed-2b09f5b29a8c |
Taxonomy | Organoheterocyclic compounds > Heteroaromatic compounds |
IUPAC Name | (4S,7S,10R,11R)-7,11-dimethyl-4-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(15),5,13(16)-triene-7,10,11-triol |
SMILES (Canonical) | CC(C)C1CCC2=COC(=C2)CC(C(CCC(C=C1)(C)O)O)(C)O |
SMILES (Isomeric) | CC(C)[C@@H]1CCC2=COC(=C2)C[C@@]([C@@H](CC[C@](C=C1)(C)O)O)(C)O |
InChI | InChI=1S/C20H32O4/c1-14(2)16-6-5-15-11-17(24-13-15)12-20(4,23)18(21)8-10-19(3,22)9-7-16/h7,9,11,13-14,16,18,21-23H,5-6,8,10,12H2,1-4H3/t16-,18-,19-,20-/m1/s1 |
InChI Key | HJQCZCWDLYWBEP-VBSBHUPXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H32O4 |
Molecular Weight | 336.50 g/mol |
Exact Mass | 336.23005950 g/mol |
Topological Polar Surface Area (TPSA) | 73.80 Ų |
XlogP | 3.10 |
There are no found synonyms. |
![2D Structure of (4S,7S,10R,11R)-7,11-dimethyl-4-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(15),5,13(16)-triene-7,10,11-triol 2D Structure of (4S,7S,10R,11R)-7,11-dimethyl-4-propan-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(15),5,13(16)-triene-7,10,11-triol](https://plantaedb.com/storage/docs/compounds/2023/11/389ce040-8607-11ee-bb88-d98924cb9d29.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.88% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.82% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.16% | 96.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.28% | 96.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.66% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.99% | 94.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.47% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.46% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 86.03% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.02% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.07% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.97% | 85.14% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.31% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.41% | 95.56% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.83% | 85.11% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.32% | 93.56% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.51% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.09% | 97.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.40% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.24% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chrozophora oblongifolia |
PubChem | 162910807 |
LOTUS | LTS0142065 |
wikiData | Q105029390 |