2-[4,5-Dihydroxy-6-(hydroxymethyl)-2-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 5dbb0de9-ea4e-48c6-a054-92eee98ae2cd |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4,5-dihydroxy-6-(hydroxymethyl)-2-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)C)OC1 |
InChI | InChI=1S/C39H64O12/c1-18-8-13-39(46-17-18)19(2)28-26(51-39)15-25-23-7-6-21-14-22(9-11-37(21,4)24(23)10-12-38(25,28)5)48-36-34(32(44)30(42)27(16-40)49-36)50-35-33(45)31(43)29(41)20(3)47-35/h18-36,40-45H,6-17H2,1-5H3 |
InChI Key | GJVMWJXVJKLODQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H64O12 |
Molecular Weight | 724.90 g/mol |
Exact Mass | 724.43977747 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 3.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.96% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.03% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.33% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.72% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.63% | 97.93% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 92.64% | 97.31% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.61% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.39% | 96.61% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.90% | 95.50% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.87% | 89.05% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 89.84% | 97.86% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.58% | 96.21% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.55% | 92.86% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.90% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.90% | 97.25% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.63% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.16% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.47% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.45% | 92.50% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 86.43% | 97.50% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.81% | 95.58% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.62% | 89.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.65% | 93.10% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.63% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.46% | 95.89% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.72% | 98.05% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.28% | 98.99% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.25% | 95.36% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.80% | 96.77% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 81.47% | 96.67% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.88% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana tabacum |
PubChem | 73813304 |
LOTUS | LTS0227829 |
wikiData | Q105009575 |