[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[7-acetyloxy-2-(4-acetyloxyphenyl)-5-hydroxy-4-oxochromen-8-yl]-2-methyloxan-3-yl] acetate
| Internal ID | cc8fd979-b317-420f-b37f-240d1fed5563 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[7-acetyloxy-2-(4-acetyloxyphenyl)-5-hydroxy-4-oxochromen-8-yl]-2-methyloxan-3-yl] acetate |
| SMILES (Canonical) | CC1C(C(C(C(O1)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=C(C=C4)OC(=O)C)O)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=C(C=C4)OC(=O)C)O)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C31H30O14/c1-13-27(42-16(4)34)30(43-17(5)35)31(44-18(6)36)29(39-13)26-24(41-15(3)33)12-22(38)25-21(37)11-23(45-28(25)26)19-7-9-20(10-8-19)40-14(2)32/h7-13,27,29-31,38H,1-6H3/t13-,27-,29+,30+,31+/m1/s1 |
| InChI Key | LOJIVXZPUZDTEA-HVZSDBRQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H30O14 |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.16355563 g/mol |
| Topological Polar Surface Area (TPSA) | 187.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[7-acetyloxy-2-(4-acetyloxyphenyl)-5-hydroxy-4-oxochromen-8-yl]-2-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/37feec50-858e-11ee-9168-1320ac2ce057.jpg "2D Structure of [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-[7-acetyloxy-2-(4-acetyloxyphenyl)-5-hydroxy-4-oxochromen-8-yl]-2-methyloxan-3-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.97% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.42% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.34% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.58% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.56% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.73% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.71% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.07% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.05% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.55% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.10% | 99.23% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.98% | 94.42% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 83.63% | 89.23% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.16% | 83.57% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.03% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 80.91% | 90.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.81% | 96.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.61% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Prosthechea michuacana |
| PubChem | 163186696 |
| LOTUS | LTS0085570 |
| wikiData | Q105154750 |