[(3S,8S,9R,10R,11R,13R,14S,15R,17R)-17-[(2R,5R)-5-ethyl-7-hydroxyheptan-2-yl]-11,15-dihydroxy-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] propanoate
| Internal ID | 20264e12-1ebd-4bd8-89b8-f1a7d0d81c65 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Oxosteroids |
| IUPAC Name | [(3S,8S,9R,10R,11R,13R,14S,15R,17R)-17-[(2R,5R)-5-ethyl-7-hydroxyheptan-2-yl]-11,15-dihydroxy-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] propanoate |
| SMILES (Canonical) | CCC(CCC(C)C1CC(C2C1(CC(C3C2C(=O)C=C4C3(CCC(C4)OC(=O)CC)C)O)C)O)CCO |
| SMILES (Isomeric) | CC[C@H](CC[C@@H](C)[C@H]1C[C@H]([C@@H]2[C@@]1(C[C@H]([C@@H]3[C@H]2C(=O)C=C4[C@@]3(CC[C@@H](C4)OC(=O)CC)C)O)C)O)CCO |
| InChI | InChI=1S/C31H50O6/c1-6-19(11-13-32)9-8-18(3)22-16-24(34)28-27-23(33)15-20-14-21(37-26(36)7-2)10-12-30(20,4)29(27)25(35)17-31(22,28)5/h15,18-19,21-22,24-25,27-29,32,34-35H,6-14,16-17H2,1-5H3/t18-,19-,21+,22-,24-,25-,27+,28+,29-,30+,31-/m1/s1 |
| InChI Key | NQDGJMGPSRWLQX-JODBWMEMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.36073931 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.60% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.04% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.51% | 94.45% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 97.48% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.96% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.85% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.05% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.82% | 97.09% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.48% | 98.10% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.03% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.39% | 95.89% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 89.03% | 98.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.90% | 89.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.25% | 95.89% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.16% | 97.79% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.12% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.71% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.66% | 82.69% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.98% | 85.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.16% | 90.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.27% | 91.07% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.59% | 96.90% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.56% | 94.23% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.47% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163085408 |
| LOTUS | LTS0066266 |
| wikiData | Q105183722 |