(3aS,6E,10Z,11aS)-6-methyl-3-methylidene-10-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one
Internal ID | 5d4442a8-7f58-460c-a33c-c414e86d745e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Germacranolides and derivatives |
IUPAC Name | (3aS,6E,10Z,11aS)-6-methyl-3-methylidene-10-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
SMILES (Canonical) | CC1=CCCC(=CC2C(CC1)C(=C)C(=O)O2)COC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | C/C/1=C\CC/C(=C/[C@H]2[C@@H](CC1)C(=C)C(=O)O2)/CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C21H30O8/c1-11-4-3-5-13(8-15-14(7-6-11)12(2)20(26)28-15)10-27-21-19(25)18(24)17(23)16(9-22)29-21/h4,8,14-19,21-25H,2-3,5-7,9-10H2,1H3/b11-4+,13-8-/t14-,15-,16+,17+,18-,19+,21+/m0/s1 |
InChI Key | OEDNDLHBXUIYOG-WXACJXOQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O8 |
Molecular Weight | 410.50 g/mol |
Exact Mass | 410.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 126.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
![2D Structure of (3aS,6E,10Z,11aS)-6-methyl-3-methylidene-10-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one 2D Structure of (3aS,6E,10Z,11aS)-6-methyl-3-methylidene-10-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/37d99770-8560-11ee-9d01-d120a4a56f81.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.51% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.68% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.08% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.33% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.06% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.03% | 97.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.39% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.23% | 97.36% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.97% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.65% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.84% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.29% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.91% | 86.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.76% | 95.83% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.76% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.45% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crepis mollis |
Launaea arborescens |
Picris hieracioides |
PubChem | 163089214 |
LOTUS | LTS0196315 |
wikiData | Q105190203 |