2-[4-Hydroxy-2-(hydroxymethyl)-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-piperidine]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | f8f870a7-511f-4af7-95b4-7667829a4eb9 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-hydroxy-2-(hydroxymethyl)-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-piperidine]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)NC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)NC1 |
InChI | InChI=1S/C45H75NO15/c1-19-9-14-45(46-17-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)57-42-39(60-41-36(53)34(51)32(49)22(4)56-41)37(54)38(29(18-47)58-42)59-40-35(52)33(50)31(48)21(3)55-40/h19-42,46-54H,7-18H2,1-6H3 |
InChI Key | BIUGDAPKHAWFIT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H75NO15 |
Molecular Weight | 870.10 g/mol |
Exact Mass | 869.51367069 g/mol |
Topological Polar Surface Area (TPSA) | 239.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.63% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.57% | 91.11% |
CHEMBL233 | P35372 | Mu opioid receptor | 94.02% | 97.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 93.62% | 89.05% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 93.50% | 97.31% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 92.85% | 95.58% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.72% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.79% | 96.61% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.44% | 96.21% |
CHEMBL237 | P41145 | Kappa opioid receptor | 90.80% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.62% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.62% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.97% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 87.79% | 97.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.93% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.76% | 95.89% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 86.57% | 96.67% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.07% | 95.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.91% | 97.86% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 85.42% | 95.36% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.32% | 97.79% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.20% | 92.86% |
CHEMBL204 | P00734 | Thrombin | 85.09% | 96.01% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.46% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.37% | 94.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.82% | 96.38% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.30% | 93.18% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.96% | 100.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.77% | 98.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.90% | 89.00% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 80.68% | 98.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum dulcamara |
Solanum tuberosum |
PubChem | 163008514 |
LOTUS | LTS0053369 |
wikiData | Q104936793 |