methyl (3S)-3-[(3S,3aS,5aR,6S,7S,9R,9aR)-9-acetyloxy-3-[(3S,5R,6S)-5-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-3a,6,9a-trimethyl-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]-3-acetyloxypropanoate
Internal ID | 9b60c105-2334-4b1a-91b0-5150af83eedb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | methyl (3S)-3-[(3S,3aS,5aR,6S,7S,9R,9aR)-9-acetyloxy-3-[(3S,5R,6S)-5-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-3a,6,9a-trimethyl-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]-3-acetyloxypropanoate |
SMILES (Canonical) | CC(=C)C1CC(C2(C(C1(C)C(CC(=O)OC)OC(=O)C)CCC3(C2=CCC3C4CC(C(OC4)C(C)(C)O)O)C)C)OC(=O)C |
SMILES (Isomeric) | CC(=C)[C@@H]1C[C@H]([C@@]2([C@@H]([C@@]1(C)[C@H](CC(=O)OC)OC(=O)C)CC[C@@]3(C2=CC[C@H]3[C@@H]4C[C@H]([C@H](OC4)C(C)(C)O)O)C)C)OC(=O)C |
InChI | InChI=1S/C35H54O9/c1-19(2)24-16-28(43-20(3)36)35(9)26-12-11-23(22-15-25(38)31(42-18-22)32(5,6)40)33(26,7)14-13-27(35)34(24,8)29(44-21(4)37)17-30(39)41-10/h12,22-25,27-29,31,38,40H,1,11,13-18H2,2-10H3/t22-,23+,24+,25-,27-,28-,29+,31+,33+,34+,35+/m1/s1 |
InChI Key | GTTYAWQXJCCLMS-SMYCZFAKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H54O9 |
Molecular Weight | 618.80 g/mol |
Exact Mass | 618.37678330 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | 5.50 |
There are no found synonyms. |
![2D Structure of methyl (3S)-3-[(3S,3aS,5aR,6S,7S,9R,9aR)-9-acetyloxy-3-[(3S,5R,6S)-5-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-3a,6,9a-trimethyl-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]-3-acetyloxypropanoate 2D Structure of methyl (3S)-3-[(3S,3aS,5aR,6S,7S,9R,9aR)-9-acetyloxy-3-[(3S,5R,6S)-5-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-3a,6,9a-trimethyl-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]-3-acetyloxypropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/37ac58f0-865b-11ee-93ed-5f279b9bf4bd.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.64% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.18% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.57% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.83% | 96.09% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 96.72% | 97.21% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.57% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.02% | 94.45% |
CHEMBL5028 | O14672 | ADAM10 | 90.63% | 97.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.54% | 96.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.73% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.61% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.54% | 91.07% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.49% | 91.19% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.35% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.39% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.16% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.27% | 98.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.78% | 93.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.40% | 92.62% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.16% | 96.77% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.97% | 96.43% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.72% | 97.14% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 84.23% | 94.97% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.83% | 95.71% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.79% | 94.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.78% | 97.28% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.09% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Trichilia elegans |
PubChem | 162904005 |
LOTUS | LTS0087397 |
wikiData | Q105019470 |