(2R,3S,4R)-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-3-ol
Internal ID | 5049fc11-16c5-434e-a60f-b6606baacfca |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 7,9-epoxylignans |
IUPAC Name | (2R,3S,4R)-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-3-ol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CC2COC(C2(CO)O)C3=CC(=C(C=C3)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C[C@@H]2CO[C@@H]([C@]2(CO)O)C3=CC(=C(C=C3)O)OC)O |
InChI | InChI=1S/C20H24O7/c1-25-17-8-12(3-5-15(17)22)7-14-10-27-19(20(14,24)11-21)13-4-6-16(23)18(9-13)26-2/h3-6,8-9,14,19,21-24H,7,10-11H2,1-2H3/t14-,19-,20-/m1/s1 |
InChI Key | XNMLTBUWDJZKPW-JSNMRZPZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O7 |
Molecular Weight | 376.40 g/mol |
Exact Mass | 376.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of (2R,3S,4R)-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-3-ol 2D Structure of (2R,3S,4R)-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(hydroxymethyl)oxolan-3-ol](https://plantaedb.com/storage/docs/compounds/2023/11/37892a70-863f-11ee-bafc-d10e816a2461.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.31% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.54% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.31% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 92.68% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.26% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.09% | 86.33% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 90.87% | 90.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.24% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.12% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.88% | 95.89% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 88.48% | 85.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.10% | 99.17% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.14% | 92.88% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.54% | 93.99% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.28% | 97.14% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.20% | 86.92% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.12% | 97.25% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.02% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.69% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.61% | 95.56% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.10% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viburnum foetidum |
PubChem | 162911635 |
LOTUS | LTS0015849 |
wikiData | Q105331783 |