(10R)-10-[(9R)-4,5-dihydroxy-2-methyl-10-oxo-9H-anthracen-9-yl]-1,8-dihydroxy-2-methoxy-6-methyl-10H-anthracen-9-one
| Internal ID | 3e846797-a05a-46e1-9cd4-8a37e99812b6 |
| Taxonomy | Benzenoids > Anthracenes |
| IUPAC Name | (10R)-10-[(9R)-4,5-dihydroxy-2-methyl-10-oxo-9H-anthracen-9-yl]-1,8-dihydroxy-2-methoxy-6-methyl-10H-anthracen-9-one |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2C4C5=C(C(=C(C=C5)OC)O)C(=O)C6=C4C=C(C=C6O)C)C=CC=C3O |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)O)C(=O)C3=C([C@H]2[C@@H]4C5=C(C(=C(C=C5)OC)O)C(=O)C6=C4C=C(C=C6O)C)C=CC=C3O |
| InChI | InChI=1S/C31H24O7/c1-13-9-17-23(15-5-4-6-19(32)25(15)30(36)26(17)20(33)11-13)24-16-7-8-22(38-3)29(35)28(16)31(37)27-18(24)10-14(2)12-21(27)34/h4-12,23-24,32-35H,1-3H3/t23-,24-/m1/s1 |
| InChI Key | VQWXSSXHRCDAOH-DNQXCXABSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H24O7 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.15220310 g/mol |
| Topological Polar Surface Area (TPSA) | 124.00 Ų |
| XlogP | 6.50 |
| There are no found synonyms. |
![2D Structure of (10R)-10-[(9R)-4,5-dihydroxy-2-methyl-10-oxo-9H-anthracen-9-yl]-1,8-dihydroxy-2-methoxy-6-methyl-10H-anthracen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/3768e8c0-8580-11ee-8e3e-fddc0541e8df.jpg "2D Structure of (10R)-10-[(9R)-4,5-dihydroxy-2-methyl-10-oxo-9H-anthracen-9-yl]-1,8-dihydroxy-2-methoxy-6-methyl-10H-anthracen-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.14% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.48% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.83% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.26% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.98% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.91% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.78% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.37% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.65% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.29% | 98.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.61% | 93.03% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.53% | 91.49% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.27% | 95.89% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.65% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.64% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.86% | 85.14% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.35% | 90.20% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.90% | 91.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.02% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.86% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senna longiracemosa |
| PubChem | 162993863 |
| LOTUS | LTS0073283 |
| wikiData | Q105291568 |