3,7-Dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-one
Internal ID | bd462971-d04c-4ea6-b958-2f3f10db0ef6 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Germacrane sesquiterpenoids |
IUPAC Name | 3,7-dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-one |
SMILES (Canonical) | CC1=CCCC(=CC(=O)C(CC1)C(C)C)C |
SMILES (Isomeric) | CC1=CCCC(=CC(=O)C(CC1)C(C)C)C |
InChI | InChI=1S/C15H24O/c1-11(2)14-9-8-12(3)6-5-7-13(4)10-15(14)16/h6,10-11,14H,5,7-9H2,1-4H3 |
InChI Key | RESNWHKKMVJDFA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24O |
Molecular Weight | 220.35 g/mol |
Exact Mass | 220.182715385 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 3.50 |
There are no found synonyms. |
![2D Structure of 3,7-Dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-one 2D Structure of 3,7-Dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/37-dimethyl-10-propan-2-ylcyclodeca-26-dien-1-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.40% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.95% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.73% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.30% | 90.71% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.81% | 96.38% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.85% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.78% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.56% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.67% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.62% | 96.09% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.83% | 89.63% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.82% | 86.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.35% | 96.43% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.32% | 96.47% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.92% | 93.03% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.47% | 90.24% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.42% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.23% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acorus calamus |
Baccharis latifolia |
Chloranthus serratus |
PubChem | 71437970 |
LOTUS | LTS0196979 |
wikiData | Q105235067 |